missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Bathocuproine, Disodium Salt, Ricca Chemical
Supplier: Ricca Chemical Company RDCB01501F1
Specifications
| Bathocuprione | |
| Disodium | |
| 98.0 | |
| C26H18N2Na2O6S2 | |
| disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O | |
| 564.54 | |
| Pouch | |
| Solid |
| Tan | |
| 52698-84-7 | |
| 100.0 | |
| MFCD00149974 | |
| RNGKZLRAVYPLJC-UHFFFAOYSA-L | |
| disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| 15678335 | |
| 1 g |
Chemical Identifiers
| 52698-84-7 | |
| 564.54 | |
| RNGKZLRAVYPLJC-UHFFFAOYSA-L | |
| 15678335 | |
| [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O |
| C26H18N2Na2O6S2 | |
| MFCD00149974 | |
| disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
Safety and Handling
ShelfLife : 60 months