missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Barium Perchlorate, Certified, 0.0100N ±0.0005N (0.005M), LabChem™
Supplier: LabChem LC116452
Specifications
| Barium Perchlorate | |
| Colorless | |
| Liquid | |
| BaCl2O8 | |
| barium perchlorate, barium diperchlorate, perchloric acid, barium salt, unii-ey48pa0c98, barium 2+ diperchlorate, barium 2+ ion diperchlorate, barium perchlorate, anhydrous, perchloric acid, bariumsalt 2:1, perchloric acid, barium salt 2:1, acmc-20alqv | |
| OOULUYZFLXDWDQ-UHFFFAOYSA-L | |
| barium(2+);diperchlorate | |
| 61623 | |
| Certified | |
| Passes Test | |
| 1g/mL | |
| 1g/mL |
| 13465-95-7,7732-18-5 | |
| 99.83,0.17 | |
| 1 L | |
| Ba(ClO4)2 | |
| Soluble in water | |
| [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Ba+2] | |
| 336.219 | |
| 336.23 | |
| 0.0100N ±0.0005N (0.005M) | |
| Amber Glass | |
| Chlorine; Barium |
Chemical Identifiers
| 13465-95-7 | |
| 336.219 | |
| barium perchlorate, barium diperchlorate, perchloric acid, barium salt, unii-ey48pa0c98, barium 2+ diperchlorate, barium 2+ ion diperchlorate, barium perchlorate, anhydrous, perchloric acid, bariumsalt 2:1, perchloric acid, barium salt 2:1, acmc-20alqv | |
| barium(2+);diperchlorate |
| BaCl2O8 | |
| OOULUYZFLXDWDQ-UHFFFAOYSA-L | |
| 61623 | |
| [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Ba+2] |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature