missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Barium Acetate, Granular, ACS, 99.0-102.0%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor B10101KG
Specifications
| 543-80-6 | |
| 1 kg | |
| MFCD00012447 | |
| [Ba++].CC([O-])=O.CC([O-])=O | |
| 255.42 | |
| ACS |
| 1 | |
| C4H6BaO4 | |
| ITHZDDVSAWDQPZ-UHFFFAOYSA-L | |
| barium(2+) diacetate | |
| 99 to 102% | |
| Poly Bottle |
Chemical Identifiers
| 543-80-6 | |
| 255.42 | |
| ITHZDDVSAWDQPZ-UHFFFAOYSA-L | |
| [Ba++].CC([O-])=O.CC([O-])=O |
| C4H6BaO4 | |
| MFCD00012447 | |
| barium(2+) diacetate |
CAUTION: For manufacturing or laboratory use only. Read and understand the label and Safety Data Sheet (SDS) prior to use.