Learn More
Azaperone, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 460830250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Azaperone | |
| 0.5% max. (60°C, 4 h) (vacuum) | |
| C19H22FN3O | |
| 25g | |
| Solubility in water: insoluble. Other solubilities: soluble in methanol, chloroform | |
| FC1=CC=C(C=C1)C(=O)CCCN1CCN(CC1)C1=CC=CC=N1 | |
| 327.40 | |
| 327.4 |
| 1649-18-9 | |
| Authentic | |
| MFCD00866692 | |
| azaperone, stresnil, fluoperidol, suicalm, azaperon, azeperone, eucalmyl, sedaperone vet, azaperona, azaperonum | |
| XTKDAFGWCDAMPY-UHFFFAOYSA-N | |
| 1-(4-fluorophenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)butan-1-one | |
| 15443 |
Chemical Identifiers
| 1649-18-9 | |
| 327.40 | |
| XTKDAFGWCDAMPY-UHFFFAOYSA-N | |
| 15443 | |
| FC1=CC=C(C=C1)C(=O)CCCN1CCN(CC1)C1=CC=CC=N1 |
| C19H22FN3O | |
| MFCD00866692 | |
| azaperone, stresnil, fluoperidol, suicalm, azaperon, azeperone, eucalmyl, sedaperone vet, azaperona, azaperonum | |
| 1-(4-fluorophenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)butan-1-one |
Safety and Handling
GHS H Statement
Toxic if swallowed.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
GHS Signal Word: Danger
EINECSNumber : 216-715-8
RUO â Research Use Only