missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Avobenzone, 97%, Spectrum™ Chemical
A2682, 70356-09-1, C20H22O3
Supplier: Spectrum Chemical Mfg Cor A268225GM
Description
Spectrum™ Chemical Avobenzone is an oil soluble ingredient used in sunscreen products to absorb the full spectrum of UVA rays. Its ability to absorb ultraviolet light over a wider range of wavelengths than many organic sunscreen agents has led to its use in many commercial preparations marketed as ′broad spectrum′ sunscreens. Avobenzone has an absorption maximum of 357 nm. It appears as an odorless, yellowish solid.Specifications
| 70356-09-1 | |
| Amber Glass Bottle | |
| MFCD00210252 | |
| XNEFYCZVKIDDMS-UHFFFAOYSA-N | |
| 1-(4-tert-butylphenyl)-3-(4-methoxyphenyl)propane-1,3-dione | |
| 97% |
| 100% | |
| C20H22O3 | |
| 25 g | |
| COC1=CC=C(C=C1)C(=O)CC(=O)C1=CC=C(C=C1)C(C)(C)C | |
| 310.39 | |
| Reagent |
Chemical Identifiers
| 70356-09-1 | |
| 310.39 | |
| XNEFYCZVKIDDMS-UHFFFAOYSA-N | |
| COC1=CC=C(C=C1)C(=O)CC(=O)C1=CC=C(C=C1)C(C)(C)C |
| C20H22O3 | |
| MFCD00210252 | |
| 1-(4-tert-butylphenyl)-3-(4-methoxyphenyl)propane-1,3-dione |