missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Arsenazo III 95.0+%, TCI America™
[Spectrophotometric reagent for U, Th, Zr and other metals, Indicator for the precipitation titration of SO4 with Ba]
Supplier: TCI America A50091G
Specifications
| Arsenazo III [Spectrophotometric reagent for U, Th, Zr and other metals, Indicator for the precipita | |
| C22H18As2N4O14S2 | |
| 1 g | |
| arsenazo iii, arsenazo iii sodium salt, 2,2'-1, 8-dihydroxy-3,6-disulfo-2, 7-naphthalene-bis azo dibenzenearsonic acid, 2,7-bis 2-arsonophenylazo-1, 8-dihydroxy-3, 6-naphthalene disulfonic acid, 2,7-bis 2-arsonophenylazo-1,8-dihydroxynaphthalene-3,6-disulfonic acid, 2,7-bis 2-arsonophenylazo chromotropic acid, 2,2'-1,8-dihydroxy-3,6-disulfonaphthylene-2,7-bisazo bisbenzenearsonic acid, 3,6-bis 2-2-arsonophenyl diazen-1-yl-4,5-dihydroxynaphthalene-2,7-disulfonic acid, 3,6-bis 2-2-arsonophenyl diazenyl-4,5-dihydroxy-2,7-naphthalenedisulfonic acid, 3,6-bis 2-2-arsonophenyl hydrazin-1-ylidene-4,5-dioxonaphthalene-2,7-disulfonic acid | |
| C1=CC=C(C(=C1)NN=C2C(=CC3=C(C2=O)C(=O)C(=NNC4=CC=CC=C4[As](=O)(O)O)C(=C3)S(=O)(=O)O)S(=O)(=O)O)[As](=O)(O)O | |
| 776.363 | |
| 776.36 |
| 1668-00-4 | |
| MFCD00036695 | |
| 3465 | |
| TVMZRHVOFZTNET-RIRMOVKSSA-N | |
| (3Z,6E)-3,6-bis[(2-arsonophenyl)hydrazinylidene]-4,5-dioxonaphthalene-2,7-disulfonic acid | |
| 9810878 | |
| ≥95.0% (T) |
Chemical Identifiers
| 1668-00-4 | |
| 776.363 | |
| TVMZRHVOFZTNET-RIRMOVKSSA-N | |
| 9810878 | |
| C1=CC=C(C(=C1)NN=C2C(=CC3=C(C2=O)C(=O)C(=NNC4=CC=CC=C4[As](=O)(O)O)C(=C3)S(=O)(=O)O)S(=O)(=O)O)[As](=O)(O)O |
| C22H18As2N4O14S2 | |
| MFCD00036695 | |
| arsenazo iii, arsenazo iii sodium salt, 2,2'-1, 8-dihydroxy-3,6-disulfo-2, 7-naphthalene-bis azo dibenzenearsonic acid, 2,7-bis 2-arsonophenylazo-1, 8-dihydroxy-3, 6-naphthalene disulfonic acid, 2,7-bis 2-arsonophenylazo-1,8-dihydroxynaphthalene-3,6-disulfonic acid, 2,7-bis 2-arsonophenylazo chromotropic acid, 2,2'-1,8-dihydroxy-3,6-disulfonaphthylene-2,7-bisazo bisbenzenearsonic acid, 3,6-bis 2-2-arsonophenyl diazen-1-yl-4,5-dihydroxynaphthalene-2,7-disulfonic acid, 3,6-bis 2-2-arsonophenyl diazenyl-4,5-dihydroxy-2,7-naphthalenedisulfonic acid, 3,6-bis 2-2-arsonophenyl hydrazin-1-ylidene-4,5-dioxonaphthalene-2,7-disulfonic acid | |
| (3Z,6E)-3,6-bis[(2-arsonophenyl)hydrazinylidene]-4,5-dioxonaphthalene-2,7-disulfonic acid |
Safety and Handling
TSCA : No