missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Arsenazo III Indicator, Certified, LabChem™
Supplier: LabChem LC114707
Specifications
| Arsenazo III Indicator | |
| 99.8,0.2 | |
| C22H18As2N4O14S2 | |
| Passes Test | |
| C1=CC=C(C(=C1)NN=C2C(=CC3=C(C2=O)C(=O)C(=NNC4=CC=CC=C4[As](=O)(O)O)C(=C3)S(=O)(=O)O)S(=O)(=O)O)[As](=O)(O)O | |
| 776.363 | |
| 776.37 | |
| Poly Bottle | |
| Arsenic and its oxides; Carbon monoxide; Carbon dioxide; Nitrogen oxides; Sulfur compounds | |
| Purple/Red | |
| Liquid |
| 1668-00-4,7732-18-5 | |
| C22H18As2N4O14S2 | |
| Soluble in water | |
| TVMZRHVOFZTNET-RIRMOVKSSA-N | |
| (3Z,6E)-3,6-bis[(2-arsonophenyl)hydrazinylidene]-4,5-dioxonaphthalene-2,7-disulfonic acid | |
| 9810878 | |
| Certified | |
| 1g/mL | |
| 1g/mL | |
| 125 mL |
Chemical Identifiers
| 1668-00-4 | |
| 776.363 | |
| 9810878 | |
| C1=CC=C(C(=C1)NN=C2C(=CC3=C(C2=O)C(=O)C(=NNC4=CC=CC=C4[As](=O)(O)O)C(=C3)S(=O)(=O)O)S(=O)(=O)O)[As](=O)(O)O |
| C22H18As2N4O14S2 | |
| TVMZRHVOFZTNET-RIRMOVKSSA-N | |
| (3Z,6E)-3,6-bis[(2-arsonophenyl)hydrazinylidene]-4,5-dioxonaphthalene-2,7-disulfonic acid |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature