Learn More
Aristolochic acid I, 96%
CAS: 313-67-7 | C17H11NO7 | 341.27 g/mol
$386.10 - $386.10
Chemical Identifiers
| CAS | 313-67-7 |
|---|---|
| Molecular Formula | C17H11NO7 |
| Molecular Weight (g/mol) | 341.27 |
| MDL Number | MFCD00004996 |
| InChI Key | BBFQZRXNYIEMAW-UHFFFAOYSA-N |
| Synonym | aristolochic acid, aristolochic acid a, aristolochic acid i, aristolochin, tardolyt, birthwort, aristolochic acid-i, aristolochine, aristolochiazaeure, unii-94218wfp5t |
| PubChem CID | 2236 |
| ChEBI | CHEBI:2825 |
| SMILES | COC1=CC=CC2=C3C(=C(C=C21)[N+](=O)[O-])C(=CC4=C3OCO4)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC226091000
|
Thermo Scientific Chemicals
226091000 |
100 mg | Glass bottle |
Each for $386.10
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 313-67-7 | |
| 341.27 | |
| BBFQZRXNYIEMAW-UHFFFAOYSA-N | |
| 2236 | |
| COC1=CC=CC2=C3C(=C(C=C21)[N+](=O)[O-])C(=CC4=C3OCO4)C(=O)O |
| C17H11NO7 | |
| MFCD00004996 | |
| aristolochic acid, aristolochic acid a, aristolochic acid i, aristolochin, tardolyt, birthwort, aristolochic acid-i, aristolochine, aristolochiazaeure, unii-94218wfp5t | |
| CHEBI:2825 |
Specifications
| 313-67-7 | |
| Yellow | |
| 95% min. (typically I+ II isomers) (HPLC) | |
| C17H11NO7 | |
| 100 mg | |
| 15, 777 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in alcohol,chloroform,ether,acetone,,acetic acid,aniline,alkalies,practically insoluble in benzene,carbon disulfide | |
| COC1=CC=CC2=C3C(=C(C=C21)[N+](=O)[O-])C(=CC4=C3OCO4)C(=O)O | |
| 2236 | |
| 341.27 | |
| Powder |
| 269°C to 270°C | |
| Authentic | |
| Glass bottle | |
| MFCD00004996 | |
| 19, V,7, 611 | |
| aristolochic acid, aristolochic acid a, aristolochic acid i, aristolochin, tardolyt, birthwort, aristolochic acid-i, aristolochine, aristolochiazaeure, unii-94218wfp5t | |
| BBFQZRXNYIEMAW-UHFFFAOYSA-N | |
| 341.27 | |
| CHEBI:2825 | |
| 96% | |
| Aristolochic acid, Mixture of I and II |
Safety and Handling
GHS H Statement
May cause cancer.
Toxic if swallowed.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Obtain special instructions before use.
Wear protective gloves/protective clothing/e
GHS Signal Word: Danger
EINECSNumber : 206-238-3
RUO – Research Use Only