Learn More
Anthracene-9-carboxylic acid, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 104880100
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Anthracene-9-carboxylic acid | |
| 723-62-6 | |
| Glass bottle | |
| MFCD00001257 | |
| 09, 705 | |
| Solubility in water: insoluble. | |
| OC(=O)C1=C2C=CC=CC2=CC2=CC=CC=C12 | |
| 222.24 | |
| CHEBI:34507 | |
| 99% |
| 99% | |
| 99% | |
| C15H10O2 | |
| 10g | |
| 9-anthracenecarboxylic acid, 9-anthroic acid, anca, 9-carboxyanthracene, 9-ac, anthracene-10-carboxylic acid, 9-anthracene carboxylic acid, a9c, spectrum_001457, tocris-0963 | |
| XGWFJBFNAQHLEF-UHFFFAOYSA-N | |
| anthracene-9-carboxylic acid | |
| 2201 | |
| 222.24 |
Chemical Identifiers
| 723-62-6 | |
| 222.24 | |
| XGWFJBFNAQHLEF-UHFFFAOYSA-N | |
| 2201 | |
| anthracene-9-carboxylic acid |
| C15H10O2 | |
| MFCD00001257 | |
| 9-anthracenecarboxylic acid, 9-anthroic acid, anca, 9-carboxyanthracene, 9-ac, anthracene-10-carboxylic acid, 9-anthracene carboxylic acid, a9c, spectrum_001457, tocris-0963 | |
| CHEBI:34507 | |
| OC(=O)C1=C2C=CC=CC2=CC2=CC=CC=C12 |
Safety and Handling
GHS H Statement
May cause respiratory irritation.
Causes serious eye irritation.
Causes skin irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attention.
Wear protective gloves/protective clothing/eye protection/face protection.
IF INHALED: Remove to fresh air and
GHS Signal Word: Warning
EINECSNumber : 211-964-9
RUO â Research Use Only