missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ammonium sulfate, Enzyme grade, ≥99%, MP Biomedicals™
Manufacturer: Mp Biomedicals 15037391
Specifications
| Ammonium Sulfate | |
| ≥99% | |
| MFCD00003391 | |
| BFNBIHQBYMNNAN-UHFFFAOYSA-N | |
| diazanium;sulfate | |
| 6097028 | |
| 132.14 | |
| Enzyme | |
| White |
| 7783-20-2 | |
| H8N2O4S | |
| actamaster | |
| [NH4+].[NH4+].[O-]S(=O)(=O)[O-] | |
| 132.134 | |
| CHEBI:62946 | |
| Crystalline Powder | |
| 1.77g/cm3 at 25°C | |
| 1kg |
Chemical Identifiers
| 7783-20-2 | |
| 132.134 | |
| BFNBIHQBYMNNAN-UHFFFAOYSA-N | |
| 6097028 | |
| diazanium;sulfate |
| H8N2O4S | |
| MFCD00003391 | |
| actamaster | |
| CHEBI:62946 | |
| [NH4+].[NH4+].[O-]S(=O)(=O)[O-] |
Safety and Handling
Recommended Storage : Store at room temperature.