missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ammonium Peroxydisulfate, Crystal, ACS, 98%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor A1225500GM
Specifications
| 7727-54-0 | |
| 500 g | |
| ROOXNKNUYICQNP-UHFFFAOYSA-N | |
| diammonium [(sulfonatoperoxy)sulfonyl]oxidanide | |
| 98% | |
| Poly Bottle |
| 1 | |
| H8N2O8S2 | |
| [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O | |
| 228.19 | |
| ACS | |
| 0.0005 |
Chemical Identifiers
| 7727-54-0 | |
| 228.19 | |
| diammonium [(sulfonatoperoxy)sulfonyl]oxidanide |
| H8N2O8S2 | |
| ROOXNKNUYICQNP-UHFFFAOYSA-N | |
| [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
CAUTION: For manufacturing or laboratory use only. Not for food or drug use. Read and understand the label and Safety Data Sheet (SDS) prior to use.