missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ammonium Dichromate, Crystal, 99.5%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor A117825KG
Specifications
| 7789-09-5 | |
| 3 to 5 | |
| Cr2H8N2O7 | |
| [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O | |
| 252.06 | |
| Reagent |
| 1 | |
| 2.5 kg | |
| JOSWYUNQBRPBDN-UHFFFAOYSA-P | |
| diammonium [(oxidodioxochromio)oxy]chromiumoylolate | |
| 99.5% | |
| Poly Pail |
Chemical Identifiers
| 7789-09-5 | |
| 252.06 | |
| diammonium [(oxidodioxochromio)oxy]chromiumoylolate |
| Cr2H8N2O7 | |
| JOSWYUNQBRPBDN-UHFFFAOYSA-P | |
| [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O |
CAUTION: For manufacturing or laboratory use only. Not for food or drug use. Read and understand the label and Safety Data Sheet (SDS) prior to use.