missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Aminopterin, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468751000
Specifications
| Aminopterin | |
| Available | |
| Powder | |
| 00036692 | |
| 225°C | |
| Soluble in DMF, DMSO | |
| NC1=NC(N)=C2N=C(CNC3=CC=C(C=C3)C(=O)NC(CCC(O)=O)C(O)=O)C=NC2=N1 | |
| 440.42 |
| Glass Bottle | |
| 54-62-6 | |
| C19H20N8O5 | |
| Light Yellow to Yellow/Brown | |
| 13-471 | |
| TVZGACDUOSZQKY-UHFFFAOYNA-N | |
| 2-[(4-{[(2,4-diaminopteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid | |
| 100 mg |
Chemical Identifiers
| 54-62-6 | |
| 440.42 | |
| TVZGACDUOSZQKY-UHFFFAOYNA-N | |
| NC1=NC(N)=C2N=C(CNC3=CC=C(C=C3)C(=O)NC(CCC(O)=O)C(O)=O)C=NC2=N1 |
| C19H20N8O5 | |
| 00036692 | |
| 2-[(4-{[(2,4-diaminopteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid |
Safety and Handling
Health hazard
Skull and crossbones
EINECSNumber : 200-209-9
RTECSNumber : MA1050000
Recommended Storage : Normal conditions