missing translation for 'onlineSavingsMsg'
Learn More
Learn More
alpha-Terpineol, Practical, 80-90%, Spectrum™ Chemical
TE107, 98-55-5, C10H18O
Supplier: Spectrum Chemical Mfg Cor TE1074LTGL
Description
Spectrum™ Chemical alpha-Terpineol, Practical , is a naturally occurring monoterpene alcohol often isolated from pine oil. The Alpha isomer is one of three isomers, and is generally the most common constituent. It has a pleasenat lilac odor and for this reason is often used in perfumes, cosmetics and flavoring agents.Specifications
| alpha-Terpineol | |
| 100% | |
| C10H18O | |
| WUOACPNHFRMFPN-VIFPVBQESA-N | |
| 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-ol | |
| 80 to 90% | |
| Liquid |
| 98-55-5 | |
| Steel Can | |
| 4 L | |
| CC1=CC[C@@H](CC1)C(C)(C)O | |
| 154.25 | |
| Practical |
Chemical Identifiers
| 98-55-5 | |
| 154.25 | |
| 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-ol |
| C10H18O | |
| WUOACPNHFRMFPN-VIFPVBQESA-N | |
| CC1=CC[C@@H](CC1)C(C)(C)O |