missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Alizarin Red S, 1% Aqueous, Certified, LabChem™
Supplier: LabChem LC106002
Specifications
| Alizarin Red S | |
| 130-22-3,7732-18-5 | |
| C14H7NaO7S | |
| Soluble in water | |
| HFVAFDPGUJEFBQ-UHFFFAOYSA-M | |
| sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate | |
| 3955344 | |
| 342.27 | |
| Poly Bottle | |
| Carbon monoxide; Carbon dioxide; Nitrogen oxides | |
| Red | |
| Liquid |
| 1% Aqueous | |
| 99,1 | |
| C14H7NaO7S | |
| Passes Test | |
| C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] | |
| 342.253 | |
| CHEBI:87358 | |
| Certified | |
| 1g/mL | |
| 1g/mL | |
| 1 L |
Chemical Identifiers
| 130-22-3 | |
| 342.253 | |
| 3955344 | |
| sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| C14H7NaO7S | |
| HFVAFDPGUJEFBQ-UHFFFAOYSA-M | |
| CHEBI:87358 | |
| C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature