missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Alizarin, 97%, pure
CAS: 72-48-0 | C14H8O4 | 240.214 g/mol
Supplier: Thermo Scientific Chemicals 153691000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Alizarin | |
| 97% | |
| 72-48-0 | |
| 100.0 | |
| 97% | |
| MFCD00001201 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in aromatic solvents, ether and hot, methanol, moderately soluble in ethanol | |
| Authentic | |
| 1,2-dihydroxyanthracene-9,10-dione | |
| 6293 | |
| 2% max. | |
| 97% | |
| Glass bottle | |
| Fine Powder |
| 287.0°C to 289.0°C | |
| 430.0°C | |
| 96.0 | |
| 96.0% min. | |
| C14H8O4 | |
| 1, 2-Dihydroxyanthraquinone, Mordant Red 11 | |
| RGCKGOZRHPZPFP-UHFFFAOYSA-N | |
| C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3)O)O | |
| 240.214 | |
| CHEBI:16866 | |
| 240.21 | |
| Pure | |
| 100 g |
Chemical Identifiers
| 72-48-0 | |
| 240.214 | |
| RGCKGOZRHPZPFP-UHFFFAOYSA-N | |
| 6293 | |
| 1,2-dihydroxyanthracene-9,10-dione |
| C14H8O4 | |
| MFCD00001201 | |
| 1, 2-Dihydroxyanthraquinone, Mordant Red 11 | |
| CHEBI:16866 | |
| C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3)O)O |
Safety and Handling
Warning
EINECSNumber : 200-782-5
RTECSNumber : CB6580000
TSCA : TSCA
RUO – Research Use Only