missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Adenosine, MP Biomedicals™
Comprised of a molecule of adenine attached to a ribose sugar molecule moiety via a β-N9-glycosidic bond. Adenosine, MP Biomedicals is a purine nucleoside that is an endogenous neurotransmitter at adenosine receptors.
Supplier: MP Biomedicals Inc 0219980325
Description
- Cardioprotective effects may relate to activation of A1 adenosine receptors and it is used for the treatment or prevention of cardiac arrhythmias (irregular heartbeat)
- The antiplatelet and anti-inflammatory actions of adenosine appear to be mediated via the A2 adenosine receptor
Specifications
| 58-61-7 | |
| C10H13N5O4 | |
| 25 g | |
| OIRDTQYFTABQOQ-KQYNXXCUSA-N | |
| NC1=C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C2=NC=N1 | |
| 267.25 | |
| CHEBI:16335 | |
| 99.0 to 101.0% | |
| Powder |
| 233°C to 238°C | |
| MFCD00005752 | |
| adenosine, adenocard, adenoscan, adenine riboside, adenosin, beta-d-adenosine, nucleocardyl, boniton, sandesin, myocol | |
| −68.0° to −72.0° (c=2, NaOH 1:20) | |
| (2R,3R,4S,5R)-2-(6-amino-9H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | |
| 60961 | |
| 267.2 | |
| USP |
Chemical Identifiers
| 58-61-7 | |
| 267.25 | |
| OIRDTQYFTABQOQ-KQYNXXCUSA-N | |
| 60961 | |
| (2R,3R,4S,5R)-2-(6-amino-9H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| C10H13N5O4 | |
| MFCD00005752 | |
| adenosine, adenocard, adenoscan, adenine riboside, adenosin, beta-d-adenosine, nucleocardyl, boniton, sandesin, myocol | |
| CHEBI:16335 | |
| NC1=C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C2=NC=N1 |
Safety and Handling
Recommended Storage : −20°C