missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Adenosine 5'-monophosphate, 99%
CAS: 61-19-8 | C10H14N5O7P | 347.22 g/mol
Supplier: Thermo Scientific Chemicals 102790050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Adenosine 5′-monophosphate | |
| 98.5 | |
| 100.0 | |
| Colorless to White | |
| Authentic | |
| Glass bottle | |
| MFCD00005750 | |
| 26, IV, 3615 | |
| adenosine 5'-monophosphate, 5'-adenylic acid, adenosine monophosphate, adenosine phosphate, adenylic acid, adenylate, phosphaden, 5'-amp, adenosine 5'-phosphate, phosphentaside | |
| 98% min. (lambda max. 260nm,pH 7) molar absorptivity 15400+/-2%,on dry basis | |
| NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 | |
| 95.0% min. (c=1, 0.2N NaOH, 430nm) 1cm cell | |
| 6083 | |
| 347.21 | |
| Crystalline Powder |
| 61-19-8 | |
| 0.76 to 0.80 (A250/A260), 0.14 to 0.16 (A280/A260) | |
| 178.0°C to 185.0°C | |
| 6% max. (105°C, 5 hrs) | |
| 98.5% min. (HPLC) | |
| C10H14N5O7P | |
| 5 g | |
| 15, 146 | |
| Solubility in water: soluble. Other solubilities: readily soluble in boiling water, soluble in ethanol | |
| UDMBCSSLTHHNCD-YPLCUDRINA-N | |
| [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate | |
| 347.22 | |
| CHEBI:16027 | |
| 99% |
Chemical Identifiers
| 61-19-8 | |
| 347.22 | |
| UDMBCSSLTHHNCD-YPLCUDRINA-N | |
| 6083 | |
| [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| C10H14N5O7P | |
| MFCD00005750 | |
| adenosine 5'-monophosphate, 5'-adenylic acid, adenosine monophosphate, adenosine phosphate, adenylic acid, adenylate, phosphaden, 5'-amp, adenosine 5'-phosphate, phosphentaside | |
| CHEBI:16027 | |
| NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
Safety and Handling
EINECSNumber : 200-500-
RUO – Research Use Only