missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Adenosine 5'-monophosphate, 99%
CAS: 61-19-8 | C10H14N5O7P | 347.22 g/mol
$106.68 - $933.61
Chemical Identifiers
| CAS | 61-19-8 |
|---|---|
| Molecular Formula | C10H14N5O7P |
| Molecular Weight (g/mol) | 347.22 |
| MDL Number | MFCD00005750 |
| InChI Key | UDMBCSSLTHHNCD-YPLCUDRINA-N |
| Synonym | adenosine 5'-monophosphate, 5'-adenylic acid, adenosine monophosphate, adenosine phosphate, adenylic acid, adenylate, phosphaden, 5'-amp, adenosine 5'-phosphate, phosphentaside |
| PubChem CID | 6083 |
| ChEBI | CHEBI:16027 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC102790050
|
Thermo Scientific Chemicals
102790050 |
5 g | Glass bottle |
Each for $106.68
|
|
||||
|
AC102790250
|
Thermo Scientific Chemicals
102790250 |
25 g | Glass bottle |
Each for $331.75
|
|
||||
|
AC102791000
|
Thermo Scientific Chemicals
102791000 |
100 g | Glass bottle |
Each for $933.61
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 61-19-8 | |
| 347.22 | |
| UDMBCSSLTHHNCD-YPLCUDRINA-N | |
| 6083 | |
| [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| C10H14N5O7P | |
| MFCD00005750 | |
| adenosine 5'-monophosphate, 5'-adenylic acid, adenosine monophosphate, adenosine phosphate, adenylic acid, adenylate, phosphaden, 5'-amp, adenosine 5'-phosphate, phosphentaside | |
| CHEBI:16027 | |
| NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
Specifications
| 61-19-8 | |
| 0.76 to 0.80 (A250/A260), 0.14 to 0.16 (A280/A260) | |
| 178.0°C to 185.0°C | |
| 6% max. (105°C, 5 hrs) | |
| 98.5% min. (HPLC) | |
| C10H14N5O7P | |
| 5 g | |
| 15, 146 | |
| Solubility in water: soluble. Other solubilities: readily soluble in boiling water, soluble in ethanol | |
| UDMBCSSLTHHNCD-YPLCUDRINA-N | |
| [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate | |
| 347.22 | |
| CHEBI:16027 | |
| 99% | |
| Adenosine 5′-monophosphate |
| 98.5 | |
| 100.0 | |
| Colorless to White | |
| Authentic | |
| Glass bottle | |
| MFCD00005750 | |
| 26, IV, 3615 | |
| adenosine 5'-monophosphate, 5'-adenylic acid, adenosine monophosphate, adenosine phosphate, adenylic acid, adenylate, phosphaden, 5'-amp, adenosine 5'-phosphate, phosphentaside | |
| 98% min. (lambda max. 260nm,pH 7) molar absorptivity 15400+/-2%,on dry basis | |
| NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 | |
| 95.0% min. (c=1, 0.2N NaOH, 430nm) 1cm cell | |
| 6083 | |
| 347.21 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 200-500-
RUO – Research Use Only