missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Adenine sulfate, 98%, synthetic
CAS: 321-30-2 | C10H12N10O4S | 368.33 g/mol
$255.47 - $569.43
Chemical Identifiers
| CAS | 321-30-2 |
|---|---|
| Molecular Formula | C10H12N10O4S |
| Molecular Weight (g/mol) | 368.33 |
| MDL Number | MFCD00213655 |
| InChI Key | LQXHSCOPYJCOMD-UHFFFAOYSA-N |
| Synonym | adenine sulfate, adenine hemisulfate, 7h-purin-6-amine sulfate 2:1, adeninsulfat, adeninium sulfate, adenine sulfate 2:1, adeninsulfat german, 1h-purin-6-amine, sulfate 2:1, diadenine sulphate, unii-741gjf3k9m |
| PubChem CID | 9449 |
| IUPAC Name | 7H-purin-6-amine;sulfuric acid |
| SMILES | OS(O)(=O)=O.NC1=C2NC=NC2=NC=N1.NC1=C2NC=NC2=NC=N1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC163630250
|
Thermo Scientific Chemicals
163630250 |
25 g | Plastic bottle |
Each for $255.47
|
|
||||
|
AC163631000
|
Thermo Scientific Chemicals
163631000 |
100 g | Plastic bottle |
Each for $569.43
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 321-30-2 | |
| 368.33 | |
| LQXHSCOPYJCOMD-UHFFFAOYSA-N | |
| 9449 | |
| OS(O)(=O)=O.NC1=C2NC=NC2=NC=N1.NC1=C2NC=NC2=NC=N1 |
| C10H12N10O4S | |
| MFCD00213655 | |
| adenine sulfate, adenine hemisulfate, 7h-purin-6-amine sulfate 2:1, adeninsulfat, adeninium sulfate, adenine sulfate 2:1, adeninsulfat german, 1h-purin-6-amine, sulfate 2:1, diadenine sulphate, unii-741gjf3k9m | |
| 7H-purin-6-amine;sulfuric acid |
Specifications
| 321-30-2 | |
| 0.74 to 0.78 (A250/A260), 0.34 to 0.38 (A280/A260) | |
| 285.0°C | |
| 2% max. (1 g, 105°C, 5 hrs) (vacuum) | |
| 98% | |
| C10H12N10O4S | |
| 25 g | |
| adenine sulfate, adenine hemisulfate, 7h-purin-6-amine sulfate 2:1, adeninsulfat, adeninium sulfate, adenine sulfate 2:1, adeninsulfat german, 1h-purin-6-amine, sulfate 2:1, diadenine sulphate, unii-741gjf3k9m | |
| 97.5% min. (lambda max. 262nm,pH 1) molar absorptivity 13100+/-2%,on dry basis | |
| OS(O)(=O)=O.NC1=C2NC=NC2=NC=N1.NC1=C2NC=NC2=NC=N1 | |
| 95% min. (c=0.5, H2O, 430nm) 1cm cell | |
| 9449 | |
| 98% | |
| Adenine sulfate, 98% |
| 97.5 | |
| 100.0 | |
| White to Yellow | |
| Authentic | |
| Plastic bottle | |
| MFCD00213655 | |
| 26, V,16, 100 | |
| Solubility in water: soluble | |
| LQXHSCOPYJCOMD-UHFFFAOYSA-N | |
| 7H-purin-6-amine;sulfuric acid | |
| 368.33 | |
| 184.17 | |
| Powder |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 206-286-5
RTECSNumber : AU7140000
TSCA : TSCA
RUO – Research Use Only