Learn More
Acridine-9-carboxylic acid hydrate, 97%
CAS: 332927-03-4 | C14H9NO2 | 223.23 g/mol
$423.54 - $1950.31
Chemical Identifiers
| CAS | 332927-03-4 |
|---|---|
| Molecular Formula | C14H9NO2 |
| Molecular Weight (g/mol) | 223.23 |
| MDL Number | MFCD00149578 |
| InChI Key | IYRYQBAAHMBIFT-UHFFFAOYSA-N |
| Synonym | 9-acridinecarboxylic acid hydrate, acridine-9-carboxylic acid hydrate, acmc-1afs1, c14h9no2.h2o, acridin-9-carboxylic acid hydrate, acridine-9-carboxylic acid hydrate 1:x |
| PubChem CID | 16211687 |
| SMILES | OC(=O)C1=C2C=CC=CC2=NC2=CC=CC=C12 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC400220050
|
Thermo Scientific Chemicals
400220050 |
5 g | Glass bottle |
Each for $423.54
|
|
||||
|
AC400220250
|
Thermo Scientific Chemicals
400220250 |
25 g | Glass bottle |
Each for $1,950.31
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 332927-03-4 | |
| 223.23 | |
| IYRYQBAAHMBIFT-UHFFFAOYSA-N | |
| 16211687 |
| C14H9NO2 | |
| MFCD00149578 | |
| 9-acridinecarboxylic acid hydrate, acridine-9-carboxylic acid hydrate, acmc-1afs1, c14h9no2.h2o, acridin-9-carboxylic acid hydrate, acridine-9-carboxylic acid hydrate 1:x | |
| OC(=O)C1=C2C=CC=CC2=NC2=CC=CC=C12 |
Specifications
| 332927-03-4 | |
| 100.0 | |
| Green-Yellow to Yellow | |
| 97% | |
| C14H9NO2 | |
| 5 g | |
| 9-acridinecarboxylic acid hydrate, acridine-9-carboxylic acid hydrate, acmc-1afs1, c14h9no2.h2o, acridin-9-carboxylic acid hydrate, acridine-9-carboxylic acid hydrate 1:x | |
| IYRYQBAAHMBIFT-UHFFFAOYSA-N | |
| acridine-9-carboxylic acid;hydrate | |
| 16211687 | |
| 97% | |
| Acridine-9-carboxylic acid hydrate |
| 96.0 | |
| 220.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00149578 | |
| 22,V,3,413 | |
| Solubility in water: soluble. Other solubilities: ethanol,pyridine,acetic acid,acetonitrile | |
| OC(=O)C1=C2C=CC=CC2=NC2=CC=CC=C12 | |
| 223.23 | |
| 241.25 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attention.
IF INHALED: Remove to fresh air and
GHS Signal Word: Warning
RUO – Research Use Only