Learn More
9-Fluorenylmethyl chloroformate, 98%
CAS: 28920-43-6 | C15H11ClO2 | 258.69 g/mol
$151.27 - $604.31
Chemical Identifiers
| CAS | 28920-43-6 |
|---|---|
| Molecular Formula | C15H11ClO2 |
| Molecular Weight (g/mol) | 258.69 |
| MDL Number | MFCD00001138 |
| InChI Key | IRXSLJNXXZKURP-UHFFFAOYSA-N |
| Synonym | 9-fluorenylmethyl chloroformate, fmoc-cl, fmoc-chloride, fmoc chloride, 9h-fluoren-9-ylmethyl chloroformate, carbonochloridic acid, 9h-fluoren-9-ylmethyl ester, 9-fluorenylmethoxycarbonyl chloride, 9-fluorenylmethylchloroformate, 9h-fluoren-9-yl methyl carbonochloridate, 9h-fluoren-9-ylmethoxy carbonyl chloride |
| PubChem CID | 34367 |
| IUPAC Name | 9H-fluoren-9-ylmethyl carbonochloridate |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC170940050
|
Thermo Scientific Chemicals
170940050 |
5 g | Glass bottle |
Each for $151.27
|
|
||||
|
AC170940250
|
Thermo Scientific Chemicals
170940250 |
25 g | Glass bottle |
Each for $604.31
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Coupling reagentChemical Identifiers
| 28920-43-6 | |
| 258.69 | |
| IRXSLJNXXZKURP-UHFFFAOYSA-N | |
| 34367 | |
| C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl |
| C15H11ClO2 | |
| MFCD00001138 | |
| 9-fluorenylmethyl chloroformate, fmoc-cl, fmoc-chloride, fmoc chloride, 9h-fluoren-9-ylmethyl chloroformate, carbonochloridic acid, 9h-fluoren-9-ylmethyl ester, 9-fluorenylmethoxycarbonyl chloride, 9-fluorenylmethylchloroformate, 9h-fluoren-9-yl methyl carbonochloridate, 9h-fluoren-9-ylmethoxy carbonyl chloride | |
| 9H-fluoren-9-ylmethyl carbonochloridate |
Specifications
| 28920-43-6 | |
| 100.0 | |
| White to Yellow | |
| 97.5% min. (HPLC) | |
| C15H11ClO2 | |
| 5 g | |
| 9-fluorenylmethyl chloroformate, fmoc-cl, fmoc-chloride, fmoc chloride, 9h-fluoren-9-ylmethyl chloroformate, carbonochloridic acid, 9h-fluoren-9-ylmethyl ester, 9-fluorenylmethoxycarbonyl chloride, 9-fluorenylmethylchloroformate, 9h-fluoren-9-yl methyl carbonochloridate, 9h-fluoren-9-ylmethoxy carbonyl chloride | |
| IRXSLJNXXZKURP-UHFFFAOYSA-N | |
| 9H-fluoren-9-ylmethyl carbonochloridate | |
| 34367 | |
| 98% | |
| 9-Fluorenylmethyl chloroformate |
| 97.5 | |
| 63.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00001138 | |
| 15, 4190 | |
| Solubility in water: decomposes in water.,acetone | |
| C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl | |
| 258.69 | |
| 258.69 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
Causes severe skin burns and eye damage.
Contact with water liberates toxic gas.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and kee
GHS Signal Word: Danger
EINECSNumber : 249-313-6
RUO – Research Use Only