missing translation for 'onlineSavingsMsg'
Learn More
Learn More
9-Fluorenone, 99+%
CAS: 486-25-9 | C13H8O | 180.21 g/mol
$123.67 - $460.18
Chemical Identifiers
| CAS | 486-25-9 |
|---|---|
| InChI Key | YLQWCDOCJODRMT-UHFFFAOYSA-N |
| Synonym | 9-fluorenone, 9h-fluoren-9-one, fluorenone, 9-oxofluorene, diphenylene ketone, unii-az9t83s2aq, ccris 593, 9h-fluorene-9-one, az9t83s2aq, 9-fluoreneone |
| PubChem CID | 10241 |
| ChEBI | CHEBI:17922 |
| IUPAC Name | fluoren-9-one |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC119201000
|
Thermo Scientific Chemicals
119201000 |
100 g | Plastic bottle |
Each for $123.67
|
|
||||
|
AC119205000
|
Thermo Scientific Chemicals
119205000 |
500 g | Plastic bottle |
Each for $460.18
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 486-25-9 | |
| 9-fluorenone, 9h-fluoren-9-one, fluorenone, 9-oxofluorene, diphenylene ketone, unii-az9t83s2aq, ccris 593, 9h-fluorene-9-one, az9t83s2aq, 9-fluoreneone | |
| CHEBI:17922 | |
| C1=CC=C2C(=C1)C3=CC=CC=C3C2=O |
| YLQWCDOCJODRMT-UHFFFAOYSA-N | |
| 10241 | |
| fluoren-9-one |
Specifications
| 486-25-9 | |
| Yellow | |
| 163°C | |
| 99% min. (GC) | |
| C13H8O | |
| 07,465 | |
| Solubility in water: insoluble. | |
| C1=CC=C2C(=C1)C3=CC=CC=C3C2=O | |
| 180.21 | |
| CHEBI:17922 | |
| 99+% | |
| 9-Fluorenone |
| 81.0°C to 85.0°C | |
| 342.0°C | |
| Authentic | |
| Plastic bottle | |
| 100 g | |
| 9-fluorenone, 9h-fluoren-9-one, fluorenone, 9-oxofluorene, diphenylene ketone, unii-az9t83s2aq, ccris 593, 9h-fluorene-9-one, az9t83s2aq, 9-fluoreneone | |
| YLQWCDOCJODRMT-UHFFFAOYSA-N | |
| fluoren-9-one | |
| 10241 | |
| 180.21 | |
| Crystalline Powder or Flakes |
Safety and Handling
EINECSNumber : 207-630-7
RUO – Research Use Only