missing translation for 'onlineSavingsMsg'
Learn More
Learn More
9-Bromophenanthrene, 96%
CAS: 573-17-1 | C14H9Br | 257.13 g/mol
Supplier: Thermo Scientific Chemicals 107240250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 9-Bromophenanthrene | |
| 573-17-1 | |
| 100.0 | |
| Yellow | |
| >110°C | |
| 95% min. (GC) | |
| C14H9Br | |
| 25 g | |
| 9-phenanthryl bromide, phenanthrene, 9-bromo, 9-phenathryl bromide, 9-bromo-phenanthrene, 9-bromo phenanthrene, 9-bromophenathrene, 9-bromanylphenanthrene, pubchem13993, acmc-1b0zz, 9-bromophenanthrene | |
| C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)Br | |
| 257.13 | |
| 257.13 | |
| Powder |
| 96% | |
| 95.0 | |
| 60°C to 65°C | |
| 180°C to 190°C (2.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| MFCD00001174 | |
| 05, 671 | |
| RSQXKVWKJVUZDG-UHFFFAOYSA-N | |
| 9-bromophenanthrene | |
| 11309 | |
| 96% |
Chemical Identifiers
| 573-17-1 | |
| 257.13 | |
| RSQXKVWKJVUZDG-UHFFFAOYSA-N | |
| 11309 | |
| C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)Br |
| C14H9Br | |
| MFCD00001174 | |
| 9-phenanthryl bromide, phenanthrene, 9-bromo, 9-phenathryl bromide, 9-bromo-phenanthrene, 9-bromo phenanthrene, 9-bromophenathrene, 9-bromanylphenanthrene, pubchem13993, acmc-1b0zz, 9-bromophenanthrene | |
| 9-bromophenanthrene |
Safety and Handling
EINECSNumber : 209-351-6
RTECSNumber : SF7197000
RUO – Research Use Only