missing translation for 'onlineSavingsMsg'
Learn More
Learn More
9-Bromophenanthrene, 96%
CAS: 573-17-1 | C14H9Br | 257.13 g/mol
$71.38 - $400.23
Chemical Identifiers
| CAS | 573-17-1 |
|---|---|
| Molecular Formula | C14H9Br |
| Molecular Weight (g/mol) | 257.13 |
| MDL Number | MFCD00001174 |
| InChI Key | RSQXKVWKJVUZDG-UHFFFAOYSA-N |
| Synonym | 9-phenanthryl bromide, phenanthrene, 9-bromo, 9-phenathryl bromide, 9-bromo-phenanthrene, 9-bromo phenanthrene, 9-bromophenathrene, 9-bromanylphenanthrene, pubchem13993, acmc-1b0zz, 9-bromophenanthrene |
| PubChem CID | 11309 |
| IUPAC Name | 9-bromophenanthrene |
| SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)Br |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC107240100
|
Thermo Scientific Chemicals
107240100 |
10 g | Glass bottle |
Each for $71.38
|
|
||||
|
AC107240250
|
Thermo Scientific Chemicals
107240250 |
25 g | Glass bottle |
Each for $128.00
|
|
||||
|
AC107241000
|
Thermo Scientific Chemicals
107241000 |
100 g | Glass bottle |
Each for $400.23
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 573-17-1 | |
| 257.13 | |
| RSQXKVWKJVUZDG-UHFFFAOYSA-N | |
| 11309 | |
| C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)Br |
| C14H9Br | |
| MFCD00001174 | |
| 9-phenanthryl bromide, phenanthrene, 9-bromo, 9-phenathryl bromide, 9-bromo-phenanthrene, 9-bromo phenanthrene, 9-bromophenathrene, 9-bromanylphenanthrene, pubchem13993, acmc-1b0zz, 9-bromophenanthrene | |
| 9-bromophenanthrene |
Specifications
| 573-17-1 | |
| 100.0 | |
| Yellow | |
| >110°C | |
| 95% min. (GC) | |
| C14H9Br | |
| 10 g | |
| 9-phenanthryl bromide, phenanthrene, 9-bromo, 9-phenathryl bromide, 9-bromo-phenanthrene, 9-bromo phenanthrene, 9-bromophenathrene, 9-bromanylphenanthrene, pubchem13993, acmc-1b0zz, 9-bromophenanthrene | |
| C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)Br | |
| 257.13 | |
| 257.13 | |
| Powder |
| 95.0 | |
| 60°C to 65°C | |
| 180°C to 190°C (2.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| MFCD00001174 | |
| 05, 671 | |
| RSQXKVWKJVUZDG-UHFFFAOYSA-N | |
| 9-bromophenanthrene | |
| 11309 | |
| 96% | |
| 9-Bromophenanthrene, 96% |
Safety and Handling
EINECSNumber : 209-351-6
RTECSNumber : SF7197000
RUO – Research Use Only