missing translation for 'onlineSavingsMsg'
Learn More
Learn More
8-Hydroxy-7-iodo-5-quinolinesulfonic Acid, For Spectrophotometric Det. of Fe(III), 98.5%, MilliporeSigma™ Supelco™
Reagent for the extraction and spectrophotometric determination of Fe
Supplier: Merck Emd Millipore 55370100G
Specifications
| 547-91-1 | |
| Glass Bottle | |
| C9H6INO4S | |
| 100 g | |
| FNXKBSAUKFCXIK-UHFFFAOYSA-M | |
| sodium 8-hydroxy-7-iodoquinoline-5-sulfonic acid hydrogen carbonate | |
| 351.12 |
| 269°C to 270°C (decomposition) | |
| C10H7INNaO7S | |
| MFCD00006793 | |
| Ferron; Iodoxyquinolinesulfonic acid | |
| [Na+].OC([O-])=O.OC1=C2N=CC=CC2=C(C=C1I)S(O)(=O)=O | |
| 435.12 | |
| ≥98.5% |
Chemical Identifiers
| 547-91-1 | |
| 435.12 | |
| FNXKBSAUKFCXIK-UHFFFAOYSA-M | |
| sodium 8-hydroxy-7-iodoquinoline-5-sulfonic acid hydrogen carbonate |
| C10H7INNaO7S | |
| MFCD00006793 | |
| Ferron; Iodoxyquinolinesulfonic acid | |
| [Na+].OC([O-])=O.OC1=C2N=CC=CC2=C(C=C1I)S(O)(=O)=O |
Safety and Handling
RTECSNumber : VC2800000