missing translation for 'onlineSavingsMsg'
Learn More
Learn More
8-Amino-1-naphthol-3,6-disulfonic acid, monosodium salt monohydrate, 80%, tech., Thermo Scientific™
$45.63 - $1,015.85
Chemical Identifiers
| CAS | 5460-09-3 |
|---|---|
| Molecular Formula | C10H8NNaO7S2·H2O |
| Molecular Weight (g/mol) | 359.32 |
| MDL Number | MFCD00150460 |
| InChI Key | QPILZZVXGUNELN-UHFFFAOYSA-M |
| Synonym | h acid sodium, 1-amino-8-naphthol-3,6-disulfonic acid monosodiumsalt, 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid 2-sodium salt |
| PubChem CID | 102116466 |
| IUPAC Name | sodium;8-amino-3,6-disulfonaphthalen-1-olate |
| SMILES | C1=C2C=C(C=C(C2=C(C=C1S(=O)(=O)O)N)[O-])S(=O)(=O)O.[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|
AC400840050
|
N/A | 5g | Glass bottle |
Each for $45.63
|
|
||||
|
AC400841000
|
N/A | 100g | Plastic bottle |
Each for $188.28
|
|
||||
|
AC400845000
|
N/A | 500g | Plastic Bottle |
Each for $1,015.85
|
|
||||
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 5460-09-3 | |
| 359.32 | |
| QPILZZVXGUNELN-UHFFFAOYSA-M | |
| 102116466 | |
| C1=C2C=C(C=C(C2=C(C=C1S(=O)(=O)O)N)[O-])S(=O)(=O)O.[Na+] |
| C10H8NNaO7S2·H2O | |
| MFCD00150460 | |
| h acid sodium, 1-amino-8-naphthol-3,6-disulfonic acid monosodiumsalt, 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid 2-sodium salt | |
| sodium;8-amino-3,6-disulfonaphthalen-1-olate |
Specifications
| 5460-09-3 | |
| 100.0 | |
| Authentic | |
| C10H8NNaO7S2·H2O | |
| h acid sodium, 1-amino-8-naphthol-3,6-disulfonic acid monosodiumsalt, 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid 2-sodium salt | |
| QPILZZVXGUNELN-UHFFFAOYSA-M | |
| sodium;8-amino-3,6-disulfonaphthalen-1-olate | |
| 102116466 | |
| 80% | |
| 8-Amino-1-naphthol-3, 6-disulfonic acid, monosodium salt monohydrate |
| 75.0 | |
| 4 % to 6 % (1 g, 150°C, 4 hrs) | |
| 75% min. (HPLC) | |
| MFCD00150460 | |
| Solubility in water: slightly soluble. | |
| C1=C2C=C(C=C(C2=C(C=C1S(=O)(=O)O)N)[O-])S(=O)(=O)O.[Na+] | |
| 359.32 | |
| 359.32 | |
| Technical |
Safety and Handling
EINECSNumber : 226-736-4
RUO – Research Use Only