missing translation for 'onlineSavingsMsg'
Learn More
Learn More
8-Amino-1-naphthol-3,6-disulfonic acid, monosodium salt monohydrate, 80%, tech., Thermo Scientific™
Supplier: Thermo Scientific Chemicals 400841000
| Quantity | 100g |
|---|---|
| Packaging | Plastic bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 5460-09-3 | |
| 359.32 | |
| QPILZZVXGUNELN-UHFFFAOYSA-M | |
| 62580 | |
| [Na+].NC1=C2C(O)=CC(=CC2=CC(=C1)S(O)(=O)=O)S([O-])(=O)=O |
| C10H8NNaO7S2·H2O | |
| MFCD00150460 | |
| piperonyl isobutyrate, unii-y8hbr1acya, y8hbr1acya, piperonyl 2-methylpropanoate, heliotropyl 2-methylpropanoate, isobutyric acid piperonyl ester, propanoic acid, 2-methyl-, 1,3-benzodioxol-5-ylmethyl ester, 1,3-benzodioxol-5-ylmethyl isobutyrate, 3,4-methylenedioxybenzyl 2-methylpropanoate, isobutyric acid 3,4-methylenedioxybenzyl ester | |
| 1,3-benzodioxol-5-ylmethyl 2-methylpropanoate |
Specifications
| 8-Amino-1-naphthol-3, 6-disulfonic acid, monosodium salt monohydrate | |
| 75.0 | |
| 4 % to 6 % (1 g, 150°C, 4 hrs) | |
| 75% min. (HPLC) | |
| C10H8NNaO7S2·H2O | |
| MFCD00150460 | |
| Solubility in water: slightly soluble. | |
| [Na+].NC1=C2C(O)=CC(=CC2=CC(=C1)S(O)(=O)=O)S([O-])(=O)=O | |
| 359.32 | |
| 359.32 | |
| Technical |
| 5460-09-3 | |
| 100.0 | |
| Authentic | |
| Plastic bottle | |
| 100g | |
| piperonyl isobutyrate, unii-y8hbr1acya, y8hbr1acya, piperonyl 2-methylpropanoate, heliotropyl 2-methylpropanoate, isobutyric acid piperonyl ester, propanoic acid, 2-methyl-, 1,3-benzodioxol-5-ylmethyl ester, 1,3-benzodioxol-5-ylmethyl isobutyrate, 3,4-methylenedioxybenzyl 2-methylpropanoate, isobutyric acid 3,4-methylenedioxybenzyl ester | |
| QPILZZVXGUNELN-UHFFFAOYSA-M | |
| 1,3-benzodioxol-5-ylmethyl 2-methylpropanoate | |
| 62580 | |
| 80% |
Safety and Handling
EINECSNumber : 226-736-4