missing translation for 'onlineSavingsMsg'
Learn More
Learn More
8-Amino-1-naphthol-3,6-disulfonic acid, monosodium salt monohydrate, 80%, tech., Thermo Scientific™
Supplier: Thermo Scientific Chemicals 400845000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 8-Amino-1-naphthol-3, 6-disulfonic acid, monosodium salt monohydrate | |
| 75.0 | |
| 4 % to 6 % (1 g, 150°C, 4 hrs) | |
| 75% min. (HPLC) | |
| C10H8NNaO7S2·H2O | |
| 500g | |
| Solubility in water: slightly soluble. | |
| C1=C2C=C(C=C(C2=C(C=C1S(=O)(=O)O)N)[O-])S(=O)(=O)O.[Na+] | |
| 359.32 | |
| 359.32 | |
| Technical |
| 5460-09-3 | |
| 100.0 | |
| Authentic | |
| Plastic Bottle | |
| MFCD00150460 | |
| h acid sodium, 1-amino-8-naphthol-3,6-disulfonic acid monosodiumsalt, 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid 2-sodium salt | |
| QPILZZVXGUNELN-UHFFFAOYSA-M | |
| sodium;8-amino-3,6-disulfonaphthalen-1-olate | |
| 102116466 | |
| 80% |
Chemical Identifiers
| 5460-09-3 | |
| 359.32 | |
| QPILZZVXGUNELN-UHFFFAOYSA-M | |
| 102116466 | |
| C1=C2C=C(C=C(C2=C(C=C1S(=O)(=O)O)N)[O-])S(=O)(=O)O.[Na+] |
| C10H8NNaO7S2·H2O | |
| MFCD00150460 | |
| h acid sodium, 1-amino-8-naphthol-3,6-disulfonic acid monosodiumsalt, 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid 2-sodium salt | |
| sodium;8-amino-3,6-disulfonaphthalen-1-olate |
Safety and Handling
EINECSNumber : 226-736-4
RUO â Research Use Only