Learn More
7-Azaindole-5-boronic acid pinacol ester, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 455850010
| Quantity | 1g |
|---|
Chemical Identifiers
| 754214-56-7 | |
| 244.1 | |
| 5-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-1h-pyrrolo 2,3-b pyridine, 7-azaindole-5-boronic acid pinacol ester, 5-4,4,5,5-tetramethyl-1,3,2 dioxaborolan-2-yl-1h-pyrrolo 2,3-b pyridine, 5-tetramethyl-1,3,2-dioxaborolan-2-yl-1h-pyrrolo 2,3-b pyridine, pyrrolo 2,3-b pyridine-5-boronic acid, pinacol ester, pyrrolo 2,3-b pyridin-5-ylboronic acid pinacol ester, zlchem 1246, pubchem16626, acmc-209szp, ksc641k4p | |
| 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| C13H17BN2O2 | |
| UOXAMYZTYZLSCC-UHFFFAOYSA-N | |
| 24208789 | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(NC=C3)N=C2 |
Specifications
| 7-Azaindole-5-boronic acid pinacol ester | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| UOXAMYZTYZLSCC-UHFFFAOYSA-N | |
| 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine | |
| 24208789 | |
| 97% |
| 754214-56-7 | |
| 96% min. (GC) | |
| C13H17BN2O2 | |
| 5-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-1h-pyrrolo 2,3-b pyridine, 7-azaindole-5-boronic acid pinacol ester, 5-4,4,5,5-tetramethyl-1,3,2 dioxaborolan-2-yl-1h-pyrrolo 2,3-b pyridine, 5-tetramethyl-1,3,2-dioxaborolan-2-yl-1h-pyrrolo 2,3-b pyridine, pyrrolo 2,3-b pyridine-5-boronic acid, pinacol ester, pyrrolo 2,3-b pyridin-5-ylboronic acid pinacol ester, zlchem 1246, pubchem16626, acmc-209szp, ksc641k4p | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(NC=C3)N=C2 | |
| 244.1 | |
| 244.1 |
Safety and Handling
GHS H Statement Harmful if swallowed. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning