missing translation for 'onlineSavingsMsg'
Learn More
Learn More
6-Methoxy-2-naphthaleneboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America M22565G
Specifications
| 6-Methoxy-2-naphthaleneboronic Acid (contains varying amounts of Anhydride) | |
| 311°C | |
| C11H11BO3 | |
| 5 g | |
| GZFAVYWCPSMLCM-UHFFFAOYSA-N | |
| (6-methoxynaphthalen-2-yl)boronic acid | |
| 4641692 | |
| Crystalline Powder |
| 156641-98-4 | |
| White-Yellow | |
| MFCD03093087 | |
| 6-methoxy-2-naphthaleneboronic acid, 6-methoxynaphthalen-2-yl boronic acid, 6-methoxy-2-naphthylboronic acid, 6-methoxynaphthalene-2-boronic acid, 6-methoxy-2-naphthyl boronic acid, 2-methoxynaphthalene-6-boronic acid, boronic acid, 6-methoxy-2-naphthalenyl, 6-methoxy-2-naphthalenyl boronic acid, acmc-209deh, ksc489k9r | |
| COC1=CC2=CC=C(C=C2C=C1)B(O)O | |
| 202.02 | |
| 202.02 |
Chemical Identifiers
| 156641-98-4 | |
| 202.02 | |
| GZFAVYWCPSMLCM-UHFFFAOYSA-N | |
| 4641692 | |
| COC1=CC2=CC=C(C=C2C=C1)B(O)O |
| C11H11BO3 | |
| MFCD03093087 | |
| 6-methoxy-2-naphthaleneboronic acid, 6-methoxynaphthalen-2-yl boronic acid, 6-methoxy-2-naphthylboronic acid, 6-methoxynaphthalene-2-boronic acid, 6-methoxy-2-naphthyl boronic acid, 2-methoxynaphthalene-6-boronic acid, boronic acid, 6-methoxy-2-naphthalenyl, 6-methoxy-2-naphthalenyl boronic acid, acmc-209deh, ksc489k9r | |
| (6-methoxynaphthalen-2-yl)boronic acid |
Safety and Handling
TSCA : No