missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
6,13-Pentacenequinone, 99%, ACROS Organics™
$183.43 - $183.43
Chemical Identifiers
| CAS | 3029-32-1 |
|---|---|
| Molecular Formula | C22H12O2 |
| Molecular Weight (g/mol) | 308.34 |
| MDL Number | MFCD00003709 |
| InChI Key | UFCVADNIXDUEFZ-UHFFFAOYSA-N |
| Synonym | 6,13-pentacenedione |
| PubChem CID | 76415 |
| IUPAC Name | pentacene-6,13-dione |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C(=O)C4=CC5=CC=CC=C5C=C4C3=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC364270010 SDS |
Thermo Fisher Scientific
AC364270010 |
1g | Glass bottle |
Each for $183.43
|
|
AC364270050 SDS |
Thermo Fisher Scientific
AC364270050 |
5g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 3029-32-1 | |
| 308.34 | |
| UFCVADNIXDUEFZ-UHFFFAOYSA-N | |
| 76415 | |
| C1=CC=C2C=C3C(=CC2=C1)C(=O)C4=CC5=CC=CC=C5C=C4C3=O |
| C22H12O2 | |
| MFCD00003709 | |
| 6,13-pentacenedione | |
| pentacene-6,13-dione |
Specifications
| Authentic | |
| Yellow | |
| 1g | |
| 98.5 | |
| 98.5% min. (HPLC) | |
| MFCD00003709 | |
| 6,13-pentacenedione | |
| UFCVADNIXDUEFZ-UHFFFAOYSA-N | |
| pentacene-6,13-dione | |
| 76415 | |
| Powder | |
| 6, 13-Pentacenequinone, 99% |
| Glass bottle | |
| 394.0°C | |
| 3029-32-1 | |
| 100.0 | |
| C22H12O2 | |
| 07,I,451 | |
| Solubility in water: insoluble. Other solubilities: soluble in ethanol,benzene,pyridine,dioxane,,dimethylformamide,nitrobenzene | |
| C1=CC=C2C=C3C(=CC2=C1)C(=O)C4=CC5=CC=CC=C5C=C4C3=O | |
| 308.34 | |
| 308.34 | |
| 99% |
Safety and Handling
GHS Signal Word: Warning