Learn More
5-Hydroxy-p-naphthoquinone, 97%
CAS: 481-39-0 | C10H6O3 | 174.16 g/mol
$114.44 - $389.63
Chemical Identifiers
| CAS | 481-39-0 |
|---|---|
| Molecular Formula | C10H6O3 |
| Molecular Weight (g/mol) | 174.16 |
| MDL Number | MFCD00001684 |
| InChI Key | KQPYUDDGWXQXHS-UHFFFAOYSA-N |
| Synonym | juglone, 5-hydroxy-1,4-naphthoquinone, 5-hydroxy-1,4-naphthalenedione, regianin, walnut extract, juglon, nucin, 5-hydroxynaphthoquinone, akhnot, yuglon |
| PubChem CID | 3806 |
| ChEBI | CHEBI:15794 |
| IUPAC Name | 5-hydroxynaphthalene-1,4-dione |
| SMILES | OC1=CC=CC2=C1C(=O)C=CC2=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC121640010
|
Thermo Scientific Chemicals
121640010 |
1 g | Glass bottle |
Each for $114.44
|
|
||||
|
AC121640050
|
Thermo Scientific Chemicals
121640050 |
5 g | Glass bottle |
Each for $389.63
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 481-39-0 | |
| 174.16 | |
| KQPYUDDGWXQXHS-UHFFFAOYSA-N | |
| 3806 | |
| 5-hydroxynaphthalene-1,4-dione |
| C10H6O3 | |
| MFCD00001684 | |
| juglone, 5-hydroxy-1,4-naphthoquinone, 5-hydroxy-1,4-naphthalenedione, regianin, walnut extract, juglon, nucin, 5-hydroxynaphthoquinone, akhnot, yuglon | |
| CHEBI:15794 | |
| OC1=CC=CC2=C1C(=O)C=CC2=O |
Specifications
| 481-39-0 | |
| 100.0 | |
| Brown to Orange | |
| 96% min. (HPLC) | |
| C10H6O3 | |
| 1 g | |
| 15, 5317 | |
| Solubility in water: soluble in hot water. Other solubilities: soluble in aq.sol. of alkalies,soluble in alcohol and ether | |
| OC1=CC=CC2=C1C(=O)C=CC2=O | |
| 174.16 | |
| CHEBI:15794 | |
| 97% | |
| 5-Hydroxy-p-naphthoquinone, 97% |
| 96.0 | |
| 161.0°C to 163.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00001684 | |
| 08, 308 | |
| juglone, 5-hydroxy-1,4-naphthoquinone, 5-hydroxy-1,4-naphthalenedione, regianin, walnut extract, juglon, nucin, 5-hydroxynaphthoquinone, akhnot, yuglon | |
| KQPYUDDGWXQXHS-UHFFFAOYSA-N | |
| 5-hydroxynaphthalene-1,4-dione | |
| 3806 | |
| 174.16 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Toxic if swallowed.
May cause respiratory irritation.
Causes skin irritation.
Very toxic to aquatic life.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye prot
GHS Signal Word: Danger
EINECSNumber : 207-567-5
RTECSNumber : QJ5775000
RUO – Research Use Only