missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
5'-Chloro-3-hydroxy-2',4'-dimethoxy-2-naphthanilide 98.0+%, TCI America™
Supplier: TCI America C210125G
Specifications
| 5′-Chloro-3-hydroxy-2′,4′-dimethoxy-2-naphthanilide | |
| 200°C | |
| C19H16ClNO4 | |
| 25 g | |
| XDWATWCCUTYUDE-UHFFFAOYSA-N | |
| N-(5-chloro-2,4-dimethoxyphenyl)-3-hydroxynaphthalene-2-carboxamide | |
| 66714 | |
| ≥98.0% (HPLC,N) |
| 92-72-8 | |
| Yellow | |
| MFCD00021635 | |
| N-(5-Chloro-2,4-dimethoxyphenyl)-3-hydroxy-2-naphthamide, Naphthol AS-ITR, Azoic Coupling Component 12 | |
| COC1=CC(=C(C=C1NC(=O)C2=CC3=CC=CC=C3C=C2O)Cl)OC | |
| 357.79 | |
| 357.79 | |
| Crystalline Powder |
Chemical Identifiers
| 92-72-8 | |
| 357.79 | |
| XDWATWCCUTYUDE-UHFFFAOYSA-N | |
| 66714 | |
| COC1=CC(=C(C=C1NC(=O)C2=CC3=CC=CC=C3C=C2O)Cl)OC |
| C19H16ClNO4 | |
| MFCD00021635 | |
| N-(5-Chloro-2,4-dimethoxyphenyl)-3-hydroxy-2-naphthamide, Naphthol AS-ITR, Azoic Coupling Component 12 | |
| N-(5-chloro-2,4-dimethoxyphenyl)-3-hydroxynaphthalene-2-carboxamide |
Safety and Handling
EINECSNumber : (5)-2281
TSCA : Yes