Learn More
5-chloro-2-nitrobenzoic acid, 99%
CAS: 2516-95-2 | C7H4ClNO4 | 201.57 g/mol
$39.66 - $223.17
Chemical Identifiers
| CAS | 2516-95-2 |
|---|---|
| Molecular Formula | C7H4ClNO4 |
| Molecular Weight (g/mol) | 201.57 |
| MDL Number | MFCD00007290 |
| InChI Key | ZKUYSJHXBFFGPU-UHFFFAOYSA-N |
| Synonym | 5-chloro-2-nitrobenzoic acid, benzoic acid, 5-chloro-2-nitro, 2-nitro-5-chlorobenzoic acid, 3-chloro-6-nitrobenzoic acid, 5-chloro-2-nitro-benzoic acid, pubchem4586, acmc-209ghs, rarechem al bo 1106, timtec-bb sbb009922, 2-nitro-5-chlorobenzoate |
| PubChem CID | 17286 |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)[N+](=O)[O-] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC109680100
|
Thermo Scientific Chemicals
109680100 |
10 g | Glass bottle |
Each for $39.66
|
|
||||
|
AC109681000
|
Thermo Scientific Chemicals
109681000 |
100 g | Plastic Bottle |
Each for $223.17
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2516-95-2 | |
| 201.57 | |
| ZKUYSJHXBFFGPU-UHFFFAOYSA-N | |
| 17286 |
| C7H4ClNO4 | |
| MFCD00007290 | |
| 5-chloro-2-nitrobenzoic acid, benzoic acid, 5-chloro-2-nitro, 2-nitro-5-chlorobenzoic acid, 3-chloro-6-nitrobenzoic acid, 5-chloro-2-nitro-benzoic acid, pubchem4586, acmc-209ghs, rarechem al bo 1106, timtec-bb sbb009922, 2-nitro-5-chlorobenzoate | |
| C1=CC(=C(C=C1Cl)C(=O)O)[N+](=O)[O-] |
Specifications
| 2516-95-2 | |
| 100.0 | |
| Green-Yellow to Yellow | |
| 0.5% max. | |
| 98.5% min. (HPLC) | |
| C7H4ClNO4 | |
| MFCD00007290 | |
| 09, 401 | |
| Solubility in water: 9,67g/L (25°C). Other solubilities: soluble in methanol | |
| C1=CC(=C(C=C1Cl)C(=O)O)[N+](=O)[O-] | |
| 17286 | |
| 99% | |
| 5-Chloro-2-nitrobenzoic acid |
| 98.5 | |
| 136°C to 139°C | |
| >100°C | |
| Authentic | |
| Glass bottle | |
| ClC6H3(NO2)CO2H | |
| 10 g | |
| 5-chloro-2-nitrobenzoic acid, benzoic acid, 5-chloro-2-nitro, 2-nitro-5-chlorobenzoic acid, 3-chloro-6-nitrobenzoic acid, 5-chloro-2-nitro-benzoic acid, pubchem4586, acmc-209ghs, rarechem al bo 1106, timtec-bb sbb009922, 2-nitro-5-chlorobenzoate | |
| ZKUYSJHXBFFGPU-UHFFFAOYSA-N | |
| 201.57 | |
| 201.57 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
EINECSNumber : 219-738-1
RUO – Research Use Only