missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ 5-Carboxyfluorescein Diacetate, Calbiochem™,
Non-fluorescent, hydrophobic agent that permeates intact cell membranes. In the cell, it is enzymatically hydrolyzed to a hydrophilic agent, 5-Carboxyfluorescein that exhibits strong fluorescence
Supplier: MilliporeSigma™ 21627550MG
Specifications
| 5-Carboxyfluorescein Diacetate | |
| Yellow | |
| 50 mg | |
| Soluble in DSMO | |
| CC(=O)OC1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)C(=O)O)C(=O)O3)C5=C(O2)C=C(C=C5)OC(=O)C | |
| 460.394 | |
| 460.4 | |
| HPLC |
| 79955-27-4 | |
| C25H16O9 | |
| 5-carboxyfluorescein diacetate, 5-cfda, 3',6'-diacetoxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-5-carboxylic acid, 5-carboxy-di-o-acetylfluorescein, 3',6'-diacetyloxy-3-oxospiro 2-benzofuran-1,9'-xanthene-5-carboxylic acid, cfda-5, spiro isobenzofuran-1 3h ,9'-9h xanthene-5-carboxylicacid, 3',6'-bis acetyloxy-3-oxo, 3',6'-bis acetyloxy-3-oxospiro 2-benzofuran-1,9'-xanthene-5-carboxylic acid, 3',6'-bis acetyloxy-3-oxospiro isobenzofuran-1 3h ,9'-9h xanthene-5-carboxylic acid, 3',6'-diacetoxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-5-carboxylic acid | |
| WPUZGNPQMIWOHE-UHFFFAOYSA-N | |
| 3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid | |
| 133314 | |
| ≥95% | |
| Solid |
Chemical Identifiers
| 79955-27-4 | |
| 460.394 | |
| 5-carboxyfluorescein diacetate, 5-cfda, 3',6'-diacetoxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-5-carboxylic acid, 5-carboxy-di-o-acetylfluorescein, 3',6'-diacetyloxy-3-oxospiro 2-benzofuran-1,9'-xanthene-5-carboxylic acid, cfda-5, spiro isobenzofuran-1 3h ,9'-9h xanthene-5-carboxylicacid, 3',6'-bis acetyloxy-3-oxo, 3',6'-bis acetyloxy-3-oxospiro 2-benzofuran-1,9'-xanthene-5-carboxylic acid, 3',6'-bis acetyloxy-3-oxospiro isobenzofuran-1 3h ,9'-9h xanthene-5-carboxylic acid, 3',6'-diacetoxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-5-carboxylic acid | |
| 3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| C25H16O9 | |
| WPUZGNPQMIWOHE-UHFFFAOYSA-N | |
| 133314 | |
| CC(=O)OC1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)C(=O)O)C(=O)O3)C5=C(O2)C=C(C=C5)OC(=O)C |
Safety and Handling
Recommended Storage : -20°C (-4°F)