missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5,5'-Dithiobis(2-nitrobenzoic Acid) 98.0+%, TCI America™
$54.06 - $473.48
Chemical Identifiers
| CAS | 69-78-3 |
|---|---|
| Molecular Formula | C14H8N2O8S2 |
| Molecular Weight (g/mol) | 396.34 |
| MDL Number | MFCD00007140 |
| InChI Key | KIUMMUBSPKGMOY-UHFFFAOYSA-N |
| Synonym | dtnb, 5,5'-dithiobis 2-nitrobenzoic acid, ellman's reagent, 3-carboxy-4-nitrophenyl disulfide, dithionitrobenzoic acid, dithiobisnitrobenzoic acid, 5,5'-disulfanediylbis 2-nitrobenzoic acid, benzoic acid, 3,3'-dithiobis 6-nitro, 3,3'-dithiobis 6-nitrobenzoic acid, 5,5'-dithio-bis 2-nitrobenzoic acid |
| PubChem CID | 6254 |
| ChEBI | CHEBI:86228 |
| IUPAC Name | 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid |
| SMILES | OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
Chemical Identifiers
| 69-78-3 | |
| 396.34 | |
| KIUMMUBSPKGMOY-UHFFFAOYSA-N | |
| 6254 | |
| 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid |
| C14H8N2O8S2 | |
| MFCD00007140 | |
| dtnb, 5,5'-dithiobis 2-nitrobenzoic acid, ellman's reagent, 3-carboxy-4-nitrophenyl disulfide, dithionitrobenzoic acid, dithiobisnitrobenzoic acid, 5,5'-disulfanediylbis 2-nitrobenzoic acid, benzoic acid, 3,3'-dithiobis 6-nitro, 3,3'-dithiobis 6-nitrobenzoic acid, 5,5'-dithio-bis 2-nitrobenzoic acid | |
| CHEBI:86228 | |
| OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
Specifications
| 69-78-3 | |
| C14H8N2O8S2 | |
| 1 g | |
| KIUMMUBSPKGMOY-UHFFFAOYSA-N | |
| 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid | |
| 6254 | |
| 396.34 | |
| Crystalline Powder |
| Yellow | |
| MFCD00007140 | |
| dtnb, 5,5'-dithiobis 2-nitrobenzoic acid, ellman's reagent, 3-carboxy-4-nitrophenyl disulfide, dithionitrobenzoic acid, dithiobisnitrobenzoic acid, 5,5'-disulfanediylbis 2-nitrobenzoic acid, benzoic acid, 3,3'-dithiobis 6-nitro, 3,3'-dithiobis 6-nitrobenzoic acid, 5,5'-dithio-bis 2-nitrobenzoic acid | |
| OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O | |
| 396.34 | |
| CHEBI:86228 | |
| ≥98.0% (HPLC,T) | |
| 5,5′-Dithiobis(2-nitrobenzoic Acid) [for Determination of SH groups] |
Safety and Handling
RTECSNumber : DG9650000
TSCA : Yes