missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ 5,5'-Dithio-bis-(2-nitrobenzoic Acid), Calbiochem™,
Sulfhydryl reagent used to characterize reactive SH groups
Supplier: MilliporeSigma™ 3221235GM
Specifications
| 5,5'-Dithio-bis-(2-nitrobenzoic Acid) | |
| Yellow | |
| MFCD00007140 | |
| dtnb, 5,5'-dithiobis 2-nitrobenzoic acid, ellman's reagent, 3-carboxy-4-nitrophenyl disulfide, dithionitrobenzoic acid, dithiobisnitrobenzoic acid, 5,5'-disulfanediylbis 2-nitrobenzoic acid, benzoic acid, 3,3'-dithiobis 6-nitro, 3,3'-dithiobis 6-nitrobenzoic acid, 5,5'-dithio-bis 2-nitrobenzoic acid | |
| KIUMMUBSPKGMOY-UHFFFAOYSA-N | |
| 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid | |
| 6254 | |
| 396.4 | |
| Solid |
| 69-78-3 | |
| C14H8N2O8S2 | |
| 5 g | |
| Soluble: EtOH | |
| OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O | |
| 396.34 | |
| CHEBI:86228 | |
| ≥98% |
Chemical Identifiers
| 69-78-3 | |
| 396.34 | |
| KIUMMUBSPKGMOY-UHFFFAOYSA-N | |
| 6254 | |
| 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid |
| C14H8N2O8S2 | |
| MFCD00007140 | |
| dtnb, 5,5'-dithiobis 2-nitrobenzoic acid, ellman's reagent, 3-carboxy-4-nitrophenyl disulfide, dithionitrobenzoic acid, dithiobisnitrobenzoic acid, 5,5'-disulfanediylbis 2-nitrobenzoic acid, benzoic acid, 3,3'-dithiobis 6-nitro, 3,3'-dithiobis 6-nitrobenzoic acid, 5,5'-dithio-bis 2-nitrobenzoic acid | |
| CHEBI:86228 | |
| OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
Safety and Handling
RTECSNumber : DG9650000
Recommended Storage : 2° to 8°C (35.6° to 46.4°F); Keep container tightly closed. Keep container in a cool, well-ventilated area. Do not store above 4°C (39.2°F).