missing translation for 'onlineSavingsMsg'
Learn More
Learn More
(4R,6R)-tert-Butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 357990010
| Quantity | 1g |
|---|---|
| Packaging | Glass bottle |
Description
Chemical Identifiers
| 125971-94-0 | |
| 269.34 | |
| DPNRMEJBKMQHMC-GHMZBOCLSA-N | |
| 2734287 | |
| CC(C)(C)OC(=O)C[C@H]1C[C@@H](CC#N)OC(C)(C)O1 |
| C14H23NO4 | |
| MFCD03093958 | |
| 4r,6r-tert-butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, tert-butyl 4r,6r-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, tert-butyl 2-4r,6r-6-cyanomethyl-2,2-dimethyl-1,3-dioxan-4-yl acetate, 4r,6r-t-butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, 4r-cis-1,1-dimethylethyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, pubchem5924, 3r,5r-6-cyano-3,5-isopropylidenebisoxy hexanoic acid tert-butyl ester, 4r,3r-tert-butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, 4r,6r-tert-butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4acetate | |
| tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
Specifications
| (4R,6R)-tert-Butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate | |
| 125971-94-0 | |
| 100.0 | |
| 96% min. (GC) | |
| C14H23NO4 | |
| MFCD03093958 | |
| Solubility in water: .. Other solubilities: soluble in chloroform | |
| CC(C)(C)OC(=O)C[C@H]1C[C@@H](CC#N)OC(C)(C)O1 | |
| 269.34 | |
| 269.34 |
| 97% | |
| 96.0 | |
| Authentic | |
| Glass bottle | |
| 1g | |
| 4r,6r-tert-butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, tert-butyl 4r,6r-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, tert-butyl 2-4r,6r-6-cyanomethyl-2,2-dimethyl-1,3-dioxan-4-yl acetate, 4r,6r-t-butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, 4r-cis-1,1-dimethylethyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, pubchem5924, 3r,5r-6-cyano-3,5-isopropylidenebisoxy hexanoic acid tert-butyl ester, 4r,3r-tert-butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate, 4r,6r-tert-butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4acetate | |
| DPNRMEJBKMQHMC-GHMZBOCLSA-N | |
| tert-butyl 2-[(4R,6R)-6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate | |
| 2734287 | |
| 97% |
Promotions
Expires: 06-30-2027
Get Up to $1,800 in Chemicals with Purchase
Spend $250 or more on Thermo Fisher Scientific chemicals and get up to $1,800 to spend on additional chemicals.