missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-tert-Butylcyclohexyl Acetate (cis- and trans- mixture) 96.0+%, TCI America™
Supplier: TCI America A072325ML
Specifications
| 4-tert-Butylcyclohexyl Acetate (cis- and trans- mixture) | |
| Colorless | |
| C12H22O2 | |
| 25 mL | |
| MBZRJSQZCBXRGK-UHFFFAOYSA-N | |
| 4-tert-butylcyclohexyl acetate | |
| 36081 | |
| ≥96.0% (GC) |
| 32210-23-4 | |
| 230°C | |
| MFCD00019354 | |
| Acetic Acid 4-tert-Butylcyclohexyl Ester | |
| CC(=O)OC1CCC(CC1)C(C)(C)C | |
| 198.31 | |
| 198.31 | |
| Liquid |
Chemical Identifiers
| 32210-23-4 | |
| 198.31 | |
| MBZRJSQZCBXRGK-UHFFFAOYSA-N | |
| 36081 | |
| CC(=O)OC1CCC(CC1)C(C)(C)C |
| C12H22O2 | |
| MFCD00019354 | |
| Acetic Acid 4-tert-Butylcyclohexyl Ester | |
| 4-tert-butylcyclohexyl acetate |
Safety and Handling
EINECSNumber : (3)-2356
RTECSNumber : AF7117000
TSCA : Yes