Learn More
4-Phenylphenol, 97%
CAS: 92-69-3 | C12H10O | 170.21 g/mol
$123.39 - $462.88
Chemical Identifiers
| CAS | 92-69-3 |
|---|---|
| Molecular Formula | C12H10O |
| Molecular Weight (g/mol) | 170.21 |
| MDL Number | MFCD00002347 |
| InChI Key | YXVFYQXJAXKLAK-UHFFFAOYSA-N |
| Synonym | 4-hydroxybiphenyl, 1,1'-biphenyl-4-ol, biphenyl-4-ol, p-phenylphenol, 4-biphenylol, p-hydroxybiphenyl, 4-hydroxydiphenyl, p-hydroxydiphenyl, p-biphenylol, 4-diphenylol |
| PubChem CID | 7103 |
| ChEBI | CHEBI:34422 |
| IUPAC Name | 4-phenylphenol |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC158712500
|
Thermo Scientific Chemicals
158712500 |
250 g | Plastic bottle |
Each for $123.39
|
|
||||
|
AC158710010
|
Thermo Scientific Chemicals
158710010 |
1 kg | Plastic bottle |
Each for $462.88
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 92-69-3 | |
| 170.21 | |
| YXVFYQXJAXKLAK-UHFFFAOYSA-N | |
| 7103 | |
| 4-phenylphenol |
| C12H10O | |
| MFCD00002347 | |
| 4-hydroxybiphenyl, 1,1'-biphenyl-4-ol, biphenyl-4-ol, p-phenylphenol, 4-biphenylol, p-hydroxybiphenyl, 4-hydroxydiphenyl, p-hydroxydiphenyl, p-biphenylol, 4-diphenylol | |
| CHEBI:34422 | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)O |
Specifications
| 92-69-3 | |
| 100.0 | |
| White to Yellow | |
| 165°C | |
| 96% min. (GC) | |
| C12H10O | |
| MFCD00002347 | |
| 06,674 | |
| 4-hydroxybiphenyl, 1,1'-biphenyl-4-ol, biphenyl-4-ol, p-phenylphenol, 4-biphenylol, p-hydroxybiphenyl, 4-hydroxydiphenyl, p-hydroxydiphenyl, p-biphenylol, 4-diphenylol | |
| YXVFYQXJAXKLAK-UHFFFAOYSA-N | |
| 4-phenylphenol | |
| 7103 | |
| 170.21 | |
| Flakes |
| 96.0 | |
| >163.0°C | |
| 307.0°C | |
| Authentic | |
| Plastic bottle | |
| C6H5C6H4OH | |
| 250 g | |
| 15,7416 | |
| Solubility in water: 0.7g/L (20°C). Other solubilities: soluble in alkalies,soluble in most common organic solvents | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)O | |
| 170.21 | |
| CHEBI:34422 | |
| 97% | |
| 4-Phenylphenol, 97% |
Safety and Handling
GHS H Statement
Toxic to aquatic life with long lasting effects.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid release to the environment.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes
GHS Signal Word: Warning
EINECSNumber : 202-179-2
RTECSNumber : DV5850000
TSCA : TSCA
RUO – Research Use Only