Learn More
4-Phenoxyaniline, 97%
CAS: 139-59-3 | C12H11NO | 185.23 g/mol
$36.39 - $593.65
Chemical Identifiers
| CAS | 139-59-3 |
|---|---|
| MDL Number | MFCD00007862 |
| InChI Key | WOYZXEVUWXQVNV-UHFFFAOYSA-N |
| Synonym | p-phenoxyaniline, 4-aminodiphenyl ether, benzenamine, 4-phenoxy, 4-phenoxybenzenamine, 4-aminophenyl phenyl ether, 4-aminodifenylether, 4-amino-1-phenoxybenzene, aniline, p-phenoxy, 4-aminobiphenyl ether, 4-aminodiphenylether |
| PubChem CID | 8764 |
| IUPAC Name | 4-phenoxyaniline |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)N |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC130230050
|
Thermo Scientific Chemicals
130230050 |
5 g | Glass bottle |
Each for $36.39
|
|
||||
|
AC130231000
|
Thermo Scientific Chemicals
130231000 |
100 g | Glass bottle |
Each for $144.61
|
|
||||
|
AC130235000
|
Thermo Scientific Chemicals
130235000 |
500 g | Glass bottle |
Each for $593.65
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 139-59-3 | |
| WOYZXEVUWXQVNV-UHFFFAOYSA-N | |
| 8764 | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)N |
| MFCD00007862 | |
| p-phenoxyaniline, 4-aminodiphenyl ether, benzenamine, 4-phenoxy, 4-phenoxybenzenamine, 4-aminophenyl phenyl ether, 4-aminodifenylether, 4-amino-1-phenoxybenzene, aniline, p-phenoxy, 4-aminobiphenyl ether, 4-aminodiphenylether | |
| 4-phenoxyaniline |
Specifications
| 139-59-3 | |
| 100.0 | |
| Brown to Brown-Green | |
| 97% | |
| C12H11NO | |
| MFCD00007862 | |
| 13, 438 | |
| WOYZXEVUWXQVNV-UHFFFAOYSA-N | |
| 4-phenoxyaniline | |
| 8764 | |
| ≥96.0% | |
| 4-Phenoxyaniline |
| 96.0 | |
| 82°C to 86°C | |
| Authentic | |
| Glass bottle | |
| C6H5OC6H4NH2 | |
| 5 g | |
| p-phenoxyaniline, 4-aminodiphenyl ether, benzenamine, 4-phenoxy, 4-phenoxybenzenamine, 4-aminophenyl phenyl ether, 4-aminodifenylether, 4-amino-1-phenoxybenzene, aniline, p-phenoxy, 4-aminobiphenyl ether, 4-aminodiphenylether | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)N | |
| 185.226 | |
| 185.23 | |
| Crystalline Flakes or Powder |
Safety and Handling
GHS H Statement
Harmful if swallowed.
May cause an allergic skin reaction.
Very toxic to aquatic life with long lasting effects.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation
GHS P Statement
Wear eye protection/face protection.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Do not breathe dust/fume/gas/mist/vapors/spray.
Avoid release to the environment.
IF IN EYES: Rinse
GHS Signal Word: Warning
EINECSNumber : 205-367-2
RUO – Research Use Only