Learn More
4-Nitrobenzenesulfonic acid hydrate, 98%
CAS: 138-42-1 | C6H5NO5S | 203.17 g/mol
Supplier: Thermo Scientific Chemicals 415820250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4-Nitrobenzenesulfonic acid hydrate | |
| 138-42-1 | |
| 100.0 | |
| Beige to Orange-Yellow | |
| 97.5% min. (HPLC) | |
| C6H5NO5S | |
| MFCD09037353 | |
| 4-nitrobenzenesulfonic acid, benzenesulfonic acid, 4-nitro, p-nitrobenzenesulfonic acid, 4-nitrobenzenesulfonate, p-nitrophenylsulfonic acid, 4-nitrobenzenesulphonic acid, 4-nitro-benzenesulfonic acid, benzenesulfonic acid, p-nitro, ccris 3132, acmc-1bvgi | |
| OS(=O)(=O)C1=CC=C(C=C1)[N+]([O-])=O | |
| 203.17 | |
| 203.18 | |
| Crystalline Powder |
| pract., 85% | |
| 80.0 | |
| 105.0°C to 112.0°C | |
| Authentic | |
| Glass bottle | |
| SO3HC6H4NO2 | |
| 25 g | |
| SPXOTSHWBDUUMT-UHFFFAOYSA-N | |
| 4-nitrobenzene-1-sulfonic acid | |
| 8740 | |
| 98% |
Chemical Identifiers
| 138-42-1 | |
| 203.17 | |
| SPXOTSHWBDUUMT-UHFFFAOYSA-N | |
| 8740 | |
| OS(=O)(=O)C1=CC=C(C=C1)[N+]([O-])=O |
| C6H5NO5S | |
| MFCD09037353 | |
| 4-nitrobenzenesulfonic acid, benzenesulfonic acid, 4-nitro, p-nitrobenzenesulfonic acid, 4-nitrobenzenesulfonate, p-nitrophenylsulfonic acid, 4-nitrobenzenesulphonic acid, 4-nitro-benzenesulfonic acid, benzenesulfonic acid, p-nitro, ccris 3132, acmc-1bvgi | |
| 4-nitrobenzene-1-sulfonic acid |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Danger
EINECSNumber : 205-329-5
RUO – Research Use Only