missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Nitroanisole 98.0+%, TCI America™
$45.43 - $242.92
Chemical Identifiers
| CAS | 100-17-4 |
|---|---|
| Molecular Formula | C7H7NO3 |
| Molecular Weight (g/mol) | 153.14 |
| MDL Number | MFCD00007327 |
| InChI Key | BNUHAJGCKIQFGE-UHFFFAOYSA-N |
| Synonym | 4-nitroanisole, p-nitroanisole, 4-methoxynitrobenzene, p-methoxynitrobenzene, benzene, 1-methoxy-4-nitro, nitroanisole, p-nitroanisol, anisole, p-nitro, 4-nitrophenyl methyl ether, unii-g989z7wolh |
| PubChem CID | 7485 |
| ChEBI | CHEBI:1911 |
| IUPAC Name | 1-methoxy-4-nitrobenzene |
| SMILES | COC1=CC=C(C=C1)[N+]([O-])=O |
Chemical Identifiers
| 100-17-4 | |
| 153.14 | |
| BNUHAJGCKIQFGE-UHFFFAOYSA-N | |
| 7485 | |
| 1-methoxy-4-nitrobenzene |
| C7H7NO3 | |
| MFCD00007327 | |
| 4-nitroanisole, p-nitroanisole, 4-methoxynitrobenzene, p-methoxynitrobenzene, benzene, 1-methoxy-4-nitro, nitroanisole, p-nitroanisol, anisole, p-nitro, 4-nitrophenyl methyl ether, unii-g989z7wolh | |
| CHEBI:1911 | |
| COC1=CC=C(C=C1)[N+]([O-])=O |
Specifications
| 100-17-4 | |
| Yellow | |
| C7H7NO3 | |
| 25 g | |
| 4-nitroanisole, p-nitroanisole, 4-methoxynitrobenzene, p-methoxynitrobenzene, benzene, 1-methoxy-4-nitro, nitroanisole, p-nitroanisol, anisole, p-nitro, 4-nitrophenyl methyl ether, unii-g989z7wolh | |
| COC1=CC=C(C=C1)[N+]([O-])=O | |
| 153.14 | |
| CHEBI:1911 | |
| ≥98.0% (GC) | |
| 4-Nitroanisole |
| 54°C | |
| 274°C | |
| MFCD00007327 | |
| 3458 | |
| BNUHAJGCKIQFGE-UHFFFAOYSA-N | |
| 1-methoxy-4-nitrobenzene | |
| 7485 | |
| 153.14 | |
| Crystalline Lumps |
Safety and Handling
EINECSNumber : (3)-0787
RTECSNumber : BZ8800000
TSCA : Yes