Learn More
4-Nitroanisole, 97%
CAS: 100-17-4 | C7H7NO3 | 153.14 g/mol
Supplier: Thermo Scientific Chemicals A191520B
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4-Nitroanisole | |
| 50°C to 54°C | |
| 260°C | |
| C7H7NO3 | |
| 1000 g | |
| 1865361 | |
| 4-nitroanisole, p-nitroanisole, 4-methoxynitrobenzene, p-methoxynitrobenzene, benzene, 1-methoxy-4-nitro, nitroanisole, p-nitroanisol, anisole, p-nitro, 4-nitrophenyl methyl ether, unii-g989z7wolh | |
| COC1=CC=C(C=C1)[N+]([O-])=O | |
| 153.14 | |
| CHEBI:1911 | |
| 97% |
| 100-17-4 | |
| 1.233 | |
| 130°C (266°F) | |
| MFCD00007327 | |
| UN3458 | |
| 14,6585 | |
| BNUHAJGCKIQFGE-UHFFFAOYSA-N | |
| 1-methoxy-4-nitrobenzene | |
| 7485 | |
| 153.14 |
Chemical Identifiers
| 100-17-4 | |
| 153.14 | |
| BNUHAJGCKIQFGE-UHFFFAOYSA-N | |
| 7485 | |
| 1-methoxy-4-nitrobenzene |
| C7H7NO3 | |
| MFCD00007327 | |
| 4-nitroanisole, p-nitroanisole, 4-methoxynitrobenzene, p-methoxynitrobenzene, benzene, 1-methoxy-4-nitro, nitroanisole, p-nitroanisol, anisole, p-nitro, 4-nitrophenyl methyl ether, unii-g989z7wolh | |
| CHEBI:1911 | |
| COC1=CC=C(C=C1)[N+]([O-])=O |
Safety and Handling
GHS H Statement
H341
Suspected of causing genetic defects.
P201-P202-P281-P308+P313-P501c
H341
DOTInformation : Transport Hazard Class: 6.1; Packing Group: III; Proper Shipping Name: NITROANISOLES, SOLID
EINECSNumber : 202-825-3
RTECSNumber : BZ8800000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only