Learn More
4-Nitroaniline, 99%
CAS: 100-01-6 | C6H6N2O2 | 138.13 g/mol
$54.13 - $127.06
Chemical Identifiers
| CAS | 100-01-6 |
|---|---|
| Molecular Formula | C6H6N2O2 |
| Molecular Weight (g/mol) | 138.13 |
| MDL Number | MFCD00007858 |
| InChI Key | TYMLOMAKGOJONV-UHFFFAOYSA-N |
| Synonym | p-nitroaniline, p-nitraniline, 4-nitrobenzenamine, p-aminonitrobenzene, 4-nitraniline, benzenamine, 4-nitro, p-nitrophenylamine, 1-amino-4-nitrobenzene, aniline, p-nitro, developer p |
| PubChem CID | 7475 |
| ChEBI | CHEBI:17064 |
| IUPAC Name | 4-nitroaniline |
| SMILES | NC1=CC=C(C=C1)[N+]([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128371000
|
Thermo Scientific Chemicals
128371000 |
100 g | Glass bottle |
Each for $54.13
|
|
||||
|
AC128375000
|
Thermo Scientific Chemicals
128375000 |
500 g | Glass bottle |
Each for $127.06
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 100-01-6 | |
| 138.13 | |
| TYMLOMAKGOJONV-UHFFFAOYSA-N | |
| 7475 | |
| 4-nitroaniline |
| C6H6N2O2 | |
| MFCD00007858 | |
| p-nitroaniline, p-nitraniline, 4-nitrobenzenamine, p-aminonitrobenzene, 4-nitraniline, benzenamine, 4-nitro, p-nitrophenylamine, 1-amino-4-nitrobenzene, aniline, p-nitro, developer p | |
| CHEBI:17064 | |
| NC1=CC=C(C=C1)[N+]([O-])=O |
Specifications
| 100-01-6 | |
| Yellow to Brown | |
| 199°C | |
| 98.5% min. (GC) | |
| C6H6N2O2 | |
| MFCD00007858 | |
| 12,711 | |
| p-nitroaniline, p-nitraniline, 4-nitrobenzenamine, p-aminonitrobenzene, 4-nitraniline, benzenamine, 4-nitro, p-nitrophenylamine, 1-amino-4-nitrobenzene, aniline, p-nitro, developer p | |
| TYMLOMAKGOJONV-UHFFFAOYSA-N | |
| 4-nitroaniline | |
| 7475 | |
| 138.13 | |
| Crystalline Powder, Crystals or Flakes |
| 146.0°C to 151.0°C | |
| 332.0°C | |
| Authentic | |
| Glass bottle | |
| O2NC6H4NH2 | |
| 100 g | |
| 15,667 | |
| Solubility in water: 0.8g/L (20°C). Other solubilities: soluble in alcohol,ether,benzene and methanol,1 g soluble in 25 mL alcohol,1 g soluble in 30 mL ether | |
| NC1=CC=C(C=C1)[N+]([O-])=O | |
| 138.13 | |
| CHEBI:17064 | |
| 99% | |
| 4-Nitroaniline |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Toxic in contact with skin.
Toxic if inhaled.
May cause damage to organs through prolonged or repeated exposure.
Harmful to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breat
GHS Signal Word: Danger
EINECSNumber : 202-810-1
RUO – Research Use Only