missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Nitro-L-phenylalanine Methyl Ester Hydrochloride 98.0+%, TCI America™
Supplier: TCI America N08785G
Specifications
| 4-Nitro-L-phenylalanine Methyl Ester Hydrochloride | |
| 224°C | |
| C10H13ClN2O4 | |
| 5 g | |
| BTHMRXRBXYHLRA-FVGYRXGTSA-N | |
| methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride | |
| 11715866 | |
| ≥98.0% (HPLC,T) |
| 17193-40-7 | |
| Yellow | |
| MFCD00135754 | |
| 4-nitro-l-phenylalanine methyl ester hydrochloride, 4-nitro-l-phenylalanine methyl ester hcl, h-phe 4-no2-ome.hcl, l-4-nitrophenylalanine methyl ester hydrochloride, s-methyl 2-amino-3-4-nitrophenyl propanoate hydrochloride, s-+-4-nitrophenylalanine methyl ester hydrochloride, s-4-nitrophenylalanine methyl ester hydrochloride, h-phe 4'-no2-ome hcl, methyl 2s-2-amino-3-4-nitrophenyl propanoate hydrochloride, p-nitrophenylalanine methyl ester hydrochloride | |
| COC(=O)C(CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl | |
| 260.674 | |
| 260.67 | |
| Crystalline Powder |
Chemical Identifiers
| 17193-40-7 | |
| 260.674 | |
| BTHMRXRBXYHLRA-FVGYRXGTSA-N | |
| 11715866 | |
| COC(=O)C(CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
| C10H13ClN2O4 | |
| MFCD00135754 | |
| 4-nitro-l-phenylalanine methyl ester hydrochloride, 4-nitro-l-phenylalanine methyl ester hcl, h-phe 4-no2-ome.hcl, l-4-nitrophenylalanine methyl ester hydrochloride, s-methyl 2-amino-3-4-nitrophenyl propanoate hydrochloride, s-+-4-nitrophenylalanine methyl ester hydrochloride, s-4-nitrophenylalanine methyl ester hydrochloride, h-phe 4'-no2-ome hcl, methyl 2s-2-amino-3-4-nitrophenyl propanoate hydrochloride, p-nitrophenylalanine methyl ester hydrochloride | |
| methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride |
Safety and Handling
TSCA : No