missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-(Methylsulfonyl)phenylhydrazine Hydrochloride, 95%
CAS: 17852-67-4 | C7H10N2O2S·HCl | 222.69 g/mol
$757.56 - $757.56
Chemical Identifiers
| CAS | 17852-67-4 |
|---|---|
| Molecular Formula | C7H10N2O2S·HCl |
| Molecular Weight (g/mol) | 222.69 |
| MDL Number | MFCD00216494 |
| InChI Key | QVCMFSJTNVQJFG-UHFFFAOYSA-N |
| Synonym | 4-methylsulfonyl phenyl hydrazine hydrochloride, 4-methylsulfonyl phenylhydrazine hydrochloride, 4-methylsulphonyl phenylhydrazine hydrochloride, 4-methylsulphonylphenylhydrazine hydrochloride, 4-methanesulfonylphenyl hydrazine hydrochloride, 4-methylsulfonylphenylhydrazine hydrochloride, hydrazine, 4-methylsulfonyl phenyl-, monohydrochloride, 4-methylsulfonyl phenylhydrazine, chloride, 4-methylsulfonyl phenylhydrazine hydrochloric acid |
| PubChem CID | 2735181 |
| IUPAC Name | (4-methylsulfonylphenyl)hydrazine;hydrochloride |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)NN.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC424960100
|
Thermo Scientific Chemicals
424960100 |
10 g | Glass bottle |
Each for $757.56
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 17852-67-4 | |
| 222.69 | |
| QVCMFSJTNVQJFG-UHFFFAOYSA-N | |
| 2735181 | |
| CS(=O)(=O)C1=CC=C(C=C1)NN.Cl |
| C7H10N2O2S·HCl | |
| MFCD00216494 | |
| 4-methylsulfonyl phenyl hydrazine hydrochloride, 4-methylsulfonyl phenylhydrazine hydrochloride, 4-methylsulphonyl phenylhydrazine hydrochloride, 4-methylsulphonylphenylhydrazine hydrochloride, 4-methanesulfonylphenyl hydrazine hydrochloride, 4-methylsulfonylphenylhydrazine hydrochloride, hydrazine, 4-methylsulfonyl phenyl-, monohydrochloride, 4-methylsulfonyl phenylhydrazine, chloride, 4-methylsulfonyl phenylhydrazine hydrochloric acid | |
| (4-methylsulfonylphenyl)hydrazine;hydrochloride |
Specifications
| 17852-67-4 | |
| 100.0 | |
| White to Yellow | |
| 94% min. (Argentometry) | |
| C7H10N2O2S·HCl | |
| MFCD00216494 | |
| 4-methylsulfonyl phenyl hydrazine hydrochloride, 4-methylsulfonyl phenylhydrazine hydrochloride, 4-methylsulphonyl phenylhydrazine hydrochloride, 4-methylsulphonylphenylhydrazine hydrochloride, 4-methanesulfonylphenyl hydrazine hydrochloride, 4-methylsulfonylphenylhydrazine hydrochloride, hydrazine, 4-methylsulfonyl phenyl-, monohydrochloride, 4-methylsulfonyl phenylhydrazine, chloride, 4-methylsulfonyl phenylhydrazine hydrochloric acid | |
| QVCMFSJTNVQJFG-UHFFFAOYSA-N | |
| (4-methylsulfonylphenyl)hydrazine;hydrochloride | |
| 2735181 | |
| 95% | |
| 4-(Methylsulfonyl)phenylhydrazine hydrochloride |
| 94.0 | |
| 202°C | |
| Authentic | |
| Glass bottle | |
| H2NHNC6H4SO2CH3·HCl | |
| 10 g | |
| Solubility in water: soluble | |
| CS(=O)(=O)C1=CC=C(C=C1)NN.Cl | |
| 222.69 | |
| 222.69 | |
| Crystalline Powder |
RUO – Research Use Only