missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Methylbenzophenone, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 126352500
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 4-Methylbenzophenone | |
| 134-84-9 | |
| 100.0 | |
| 143°C | |
| 96% min. (GC) | |
| C14H12O | |
| MFCD00008553 | |
| 07, 440 | |
| 4-methylbenzophenone, phenyl p-tolyl methanone, 4-methylphenyl phenyl methanone, p-methylbenzophenone, methanone, 4-methylphenyl phenyl, p-benzoyltoluene, 4-methyl benzophenone, phenyl p-tolyl ketone, benzophenone, 4-methyl, p-benzophenone, methyl | |
| WXPWZZHELZEVPO-UHFFFAOYSA-N | |
| (4-methylphenyl)-phenylmethanone | |
| 8652 | |
| 97% |
| 97% | |
| 96.0 | |
| 326°C | |
| Authentic | |
| Plastic bottle | |
| CH3C6H4COC6H5 | |
| 250g | |
| 14, 7317 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol,ether and chloroform | |
| CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 | |
| 196.25 | |
| 196.25 |
Chemical Identifiers
| 134-84-9 | |
| 196.25 | |
| WXPWZZHELZEVPO-UHFFFAOYSA-N | |
| 8652 | |
| CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| C14H12O | |
| MFCD00008553 | |
| 4-methylbenzophenone, phenyl p-tolyl methanone, 4-methylphenyl phenyl methanone, p-methylbenzophenone, methanone, 4-methylphenyl phenyl, p-benzoyltoluene, 4-methyl benzophenone, phenyl p-tolyl ketone, benzophenone, 4-methyl, p-benzophenone, methyl | |
| (4-methylphenyl)-phenylmethanone |
Safety and Handling
EINECSNumber : 205-159-1
RTECSNumber : DJ1750000
TSCA : TSCA
RUO â Research Use Only