missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Chemical Identifiers
| CAS | 96-98-0 |
|---|---|
| Molecular Formula | C8H7NO4 |
| Molecular Weight (g/mol) | 181.147 |
| MDL Number | MFCD00007174 |
| InChI Key | BBEWSMNRCUXQRF-UHFFFAOYSA-N |
| Synonym | 4-methyl-3-nitrobenzoic acid, 3-nitro-4-methylbenzoic acid, 3-nitro-p-toluic acid, benzoic acid, 4-methyl-3-nitro, 3-nitro-para-toluic acid, m-nitro-p-toluic acid, 4-methyl-3-nitro-benzoic acid, p-toluic acid, 3-nitro, 3-nitro-4-methyl benzoic acid, benzoic acid,4-methyl-3-nitro |
| PubChem CID | 7319 |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Chemical Identifiers
| 96-98-0 | |
| 181.147 | |
| BBEWSMNRCUXQRF-UHFFFAOYSA-N | |
| 7319 |
| C8H7NO4 | |
| MFCD00007174 | |
| 4-methyl-3-nitrobenzoic acid, 3-nitro-4-methylbenzoic acid, 3-nitro-p-toluic acid, benzoic acid, 4-methyl-3-nitro, 3-nitro-para-toluic acid, m-nitro-p-toluic acid, 4-methyl-3-nitro-benzoic acid, p-toluic acid, 3-nitro, 3-nitro-4-methyl benzoic acid, benzoic acid,4-methyl-3-nitro | |
| CC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Specifications
| Yellow | |
| 25g | |
| C8H7NO4 | |
| 4-methyl-3-nitrobenzoic acid, 3-nitro-4-methylbenzoic acid, 3-nitro-p-toluic acid, benzoic acid, 4-methyl-3-nitro, 3-nitro-para-toluic acid, m-nitro-p-toluic acid, 4-methyl-3-nitro-benzoic acid, p-toluic acid, 3-nitro, 3-nitro-4-methyl benzoic acid, benzoic acid,4-methyl-3-nitro | |
| CC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] | |
| 7319 | |
| Crystal-Powder at 20°C | |
| 4-Methyl-3-nitrobenzoic Acid |
| 190°C | |
| 96-98-0 | |
| MFCD00007174 | |
| BBEWSMNRCUXQRF-UHFFFAOYSA-N | |
| 181.147 | |
| 181.15 | |
| ≥99.0% (T) |
Safety and Handling
EINECSNumber : (3)-1510
TSCA : Yes